|
|
| | tert-butyl 3-hydroxy-4-oxopiperidine-1-carboxylate Basic information |
| Product Name: | tert-butyl 3-hydroxy-4-oxopiperidine-1-carboxylate | | Synonyms: | tert-butyl 3-hydroxy-4-oxopiperidine-1-carboxylate;3-HYDROXY-4-OXO-PIPERIDINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER;1-Piperidinecarboxylic acid, 3-hydroxy-4-oxo-, 1,1-dimethylethyl ester;TERT-BUTYL 3-HYDR0XY-4-OXOPIPERIDINE-1-CARBOXYLATE;1-Boc-3-hydroxypiperidin-4-one | | CAS: | 1130156-23-8 | | MF: | C10H17NO4 | | MW: | 215.25 | | EINECS: | | | Product Categories: | | | Mol File: | 1130156-23-8.mol |  |
| | tert-butyl 3-hydroxy-4-oxopiperidine-1-carboxylate Chemical Properties |
| Boiling point | 341.9±42.0 °C(Predicted) | | density | 1.208±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 12.46±0.20(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C10H17NO4/c1-10(2,3)15-9(14)11-5-4-7(12)8(13)6-11/h8,13H,4-6H2,1-3H3 | | InChIKey | QDLQOXCJAGFXNE-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(=O)C(O)C1 |
| | tert-butyl 3-hydroxy-4-oxopiperidine-1-carboxylate Usage And Synthesis |
| | tert-butyl 3-hydroxy-4-oxopiperidine-1-carboxylate Preparation Products And Raw materials |
|