| Company Name: |
Shanghai Hengmao Biotechnology Co. , Ltd.
|
| Tel: |
18817538189 |
| Email: |
hmbsales@163.com |
| Products Intro: |
Product Name:N-(5-amino-2-fluorophenyl)-N-methylacrylamide
CAS:1706432-00-9
Purity:98 Package:1g;100g
|
| Company Name: |
A.J Chemicals
|
| Tel: |
91-9810153283 |
| Email: |
sales@ajchem.in |
| Products Intro: |
Product Name:N-(5-Amino-2-fluorophenyl)-n-methylacrylamide
CAS:1706432-00-9
|
| Company Name: |
Matrix Scientific
|
| Tel: |
803 788-9494 All other calls |
| Email: |
sales@matrixscientific.com |
| Products Intro: |
Product Name:N-(5-Amino-2-fluorophenyl)-N-methylacrylamide
CAS:1706432-00-9
|
|
| | N-(5-amino-2-fluorophenyl)-N-methylacrylamide Chemical Properties |
| Boiling point | 312.5±32.0 °C(Predicted) | | density | 1.220±0.06 g/cm3(Predicted) | | pka | 4.27±0.10(Predicted) | | InChI | InChI=1S/C10H11FN2O/c1-3-10(14)13(2)9-6-7(12)4-5-8(9)11/h3-6H,1,12H2,2H3 | | InChIKey | ZFGNAUDLKKAVJC-UHFFFAOYSA-N | | SMILES | C(N(C1=CC(N)=CC=C1F)C)(=O)C=C |
| | N-(5-amino-2-fluorophenyl)-N-methylacrylamide Usage And Synthesis |
| Uses | N-(5-amino-2-fluorophenyl)-N-methylacrylamide is an amino acid derivative and can be used as an intermediate in pharmaceutical synthesis. | | Storage conditions | N-(5-amino-2-fluorophenyl)-N-methylacrylamide storage at -4℃ (1-2weeks), longer storage period at -20℃ (1-2years). |
| | N-(5-amino-2-fluorophenyl)-N-methylacrylamide Preparation Products And Raw materials |
|