|
|
| | 5-bromo-4-((2-ethylhexyl)oxy)thiophene-2-carbaldehyde Basic information |
| | 5-bromo-4-((2-ethylhexyl)oxy)thiophene-2-carbaldehyde Chemical Properties |
| Boiling point | 383.0±37.0 °C(Predicted) | | density | 1.294±0.06 g/cm3(Predicted) | | form | liquid | | color | Brown | | InChI | InChI=1S/C13H19BrO2S/c1-3-5-6-10(4-2)9-16-12-7-11(8-15)17-13(12)14/h7-8,10H,3-6,9H2,1-2H3 | | InChIKey | VJMGHDAGOIUSEO-UHFFFAOYSA-N | | SMILES | C1(C=O)SC(Br)=C(OCC(CC)CCCC)C=1 |
| | 5-bromo-4-((2-ethylhexyl)oxy)thiophene-2-carbaldehyde Usage And Synthesis |
| Description | 5-Bromo-4-((2-ethylhexyl)oxy)-2-thiophenecarboxaldehyde (EHOThCHO-Br) is the?building block that is used?for the synthesis of ultra-narrow band-gap non-fullerene acceptors (NFAs) such as IEICO, IEICO-4F and IEICO-4Cl. | | Uses | 5-Bromo-4-((2-ethylhexyl)oxy)thiophene-2-carbaldehyde is a useful raw material in the synthesis of low band small molecule acceptor for efficient polymer solar cells. |
| | 5-bromo-4-((2-ethylhexyl)oxy)thiophene-2-carbaldehyde Preparation Products And Raw materials |
|