| Company Name: |
Hubei Changao Pharmaceutical Co., Ltd Gold
|
| Tel: |
027-87058617 13419515565 |
| Email: |
195755151@qq.com |
| Products Intro: |
Product Name:Propyl dihydrojasmonate
Purity:5% Package:1kg/RMB 260;25kg/RMB 120 Remarks:1000KG
|
| Company Name: |
Hubei Dibai Chemical Co., Ltd. Gold
|
| Tel: |
027-87058617 15872383390 |
| Email: |
hbdibo@163.com |
| Products Intro: |
Product Name:Propyl dihydrojasmonate
Purity:95% Package:1kg/RMB 800
|
| Company Name: |
Hubei Haiyue Biotechnology Co., Ltd Gold
|
| Tel: |
15926453367 |
| Email: |
haiyue1682022@163.com |
| Products Intro: |
Product Name:Propyl dihydrojasmonate
Purity:：95%, 5% Package:25kgASSAYS
|
|
| | Propyl dihydrojasmonate Basic information |
| | Propyl dihydrojasmonate Chemical Properties |
| InChI | InChI=1S/C14H24O3/c1-3-5-6-11-8-13(15)9-12(11)10-14(16)17-7-4-2/h11-12H,3-10H2,1-2H3 | | InChIKey | CYNZHIYUBCAGCK-UHFFFAOYSA-N | | SMILES | C(OCCC)(=O)CC1C(CCCC)CC(C1)=O |
| | Propyl dihydrojasmonate Usage And Synthesis |
| | Propyl dihydrojasmonate Preparation Products And Raw materials |
|