- 3,4,5-Trihydroxybenzaldehyde
-
- $15.00 / 1KG
-
2021-07-02
- CAS:13677-79-7
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 3,4,5-Trihydroxybenzaldehyde Basic information |
| Product Name: | 3,4,5-Trihydroxybenzaldehyde | | Synonyms: | 3,4,5-Trihydroxybenzaldehyde hydrate, 97%, dry wt. basis;GALLALDEHYDE;3,4,5-TRIHYDROXYBENZALDEHYDE HYDRATE 97%;3,4,5-TRIHYDROXYBNEZALDEHYDE MONOHYDRATE;3,4,5-TRIHYDROXYBENZALDHYDE;3,4,5-TRIHYDROXYBENZALDEHYDE;3,4,5-Trihydroxybenz;Pyrogallol-5-carboxaldehyde | | CAS: | 13677-79-7 | | MF: | C7H6O4 | | MW: | 154.12 | | EINECS: | 237-168-1 | | Product Categories: | Aromatic Aldehydes & Derivatives (substituted);Aromatics;Inhibitors | | Mol File: | 13677-79-7.mol |  |
| | 3,4,5-Trihydroxybenzaldehyde Chemical Properties |
| Melting point | 211-213°C | | Boiling point | 237.46°C (rough estimate) | | density | 1.3725 (rough estimate) | | refractive index | 1.6400 (estimate) | | storage temp. | Inert atmosphere,2-8°C | | solubility | Soluble in DMSO and Methanol. | | form | Solid | | pka | 7.46±0.23(Predicted) | | color | White to Pale Yellow | | Sensitive | Air Sensitive | | BRN | 2091654 | | InChI | InChI=1S/C7H6O4/c8-3-4-1-5(9)7(11)6(10)2-4/h1-3,9-11H | | InChIKey | RGZHEOWNTDJLAQ-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC(O)=C(O)C(O)=C1 | | CAS DataBase Reference | 13677-79-7(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 3,4,5-Trihydroxybenzaldehyde Usage And Synthesis |
| Chemical Properties | Tan Solid | | Uses | THBA | | Uses | 3,4,5-trihydroxybenzaldehyde from Geum japonicum has dual inhibitory effect on matrix metalloproteinase 9; inhibition of gelatinoytic activity as well as MMP-9 expression in TNF-α induced HASMC. |
| | 3,4,5-Trihydroxybenzaldehyde Preparation Products And Raw materials |
|