|
|
| | Propyl isovalerate Basic information |
| Product Name: | Propyl isovalerate | | Synonyms: | 3-methylbutanoicacidpropylester;PROPYL ISOVALERATE, NATURAL;1-Propyl isovalerate;3-Methylbutanoic acid propyl;Isovaleric acid propyl;Propyl isovalerate >=98.0%;Butanoic acid, 3-methyl-, propyl ester;Butanoicacid,3-methyl-,propylester | | CAS: | 557-00-6 | | MF: | C8H16O2 | | MW: | 144.21 | | EINECS: | 209-148-2 | | Product Categories: | | | Mol File: | 557-00-6.mol |  |
| | Propyl isovalerate Chemical Properties |
| Melting point | -63.35°C (estimate) | | Boiling point | 155.8°C | | density | 0.862 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.403 | | FEMA | 2960 | PROPYL ISOVALERATE | | Fp | 44 °C | | storage temp. | Storage temp. 2-8°C | | Appearance | Colorless to light yellow Liquid | | Odor | at 100.00 %. bitter sweet apple fruity | | Odor Type | fruity | | Odor Threshold | 0.000056ppm | | JECFA Number | 197 | | BRN | 1747146 | | InChI | InChI=1S/C8H16O2/c1-4-5-10-8(9)6-7(2)3/h7H,4-6H2,1-3H3 | | InChIKey | LSJMDWFAADPNAX-UHFFFAOYSA-N | | SMILES | C(OCCC)(=O)CC(C)C | | LogP | 2.65 | | NIST Chemistry Reference | Propyl isovalerate(557-00-6) |
| Risk Statements | 10 | | Safety Statements | 16 | | RIDADR | UN 3272 3/PG 3 | | WGK Germany | 2 | | RTECS | NY1512000 |
| | Propyl isovalerate Usage And Synthesis |
| Chemical Properties | Propyl isovalerate has a fruity odor and a bittersweet flavor similar to apple. | | Occurrence | Reported found in banana, Gruyere de Comte cheese and jackfruit. | | Preparation | By prolonged boiling of propyl alcohol with isovaleric acid in benzene in the presence of concentrated H2SO4. | | Definition | ChEBI: Propyl 3-methylbutanoate is a fatty acid ester. | | Aroma threshold values | Detection: 8.7 to 33 ppb |
| | Propyl isovalerate Preparation Products And Raw materials |
|