|
|
| | 2,6-Pyridinedicarboxylic acid monomethyl ester Basic information |
| Product Name: | 2,6-Pyridinedicarboxylic acid monomethyl ester | | Synonyms: | PYRIDINE-2,6-DICARBOXYLIC ACID MONOMETHYL ESTER;2,6-PYRIDINEDICARBOXYLIC ACID MONOMETHYL ESTER;2,6-PYRIDINEDICARBOXYLIC ACID, MONOETHYL ESTER;2,6-Pyridinedinedicarboxylic Acid Monomethyl Ester;2,6-Pyridinedicarboxylic acid, 2-methyl ester;2,6-Pyridinecarboxylic acid MonoMethyl ester;6-carbomethoxypicolinic acid;6-methoxycarbonyl-2-pyridinecarboxylic acid | | CAS: | 7170-36-7 | | MF: | C8H7NO4 | | MW: | 181.15 | | EINECS: | 808-166-3 | | Product Categories: | Pyridine;john's | | Mol File: | 7170-36-7.mol |  |
| | 2,6-Pyridinedicarboxylic acid monomethyl ester Chemical Properties |
| Melting point | 144-146°C | | Boiling point | 393°C | | density | 1.361±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 3.27±0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C8H7NO4/c1-13-8(12)6-4-2-3-5(9-6)7(10)11/h2-4H,1H3,(H,10,11) | | InChIKey | VWIOMFMPIVMLIR-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)=NC(C(O)=O)=CC=C1 | | CAS DataBase Reference | 7170-36-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | HS Code | 2933399990 |
| | 2,6-Pyridinedicarboxylic acid monomethyl ester Usage And Synthesis |
| Physical properties | White or off white powder
| | Uses | 2,6-Pyridinedicarboxylic Acid Monomethyl Ester can be used as chemical scavengers. | | Synthesis Reference(s) | Synthetic Communications, 25, p. 739, 1995 DOI: 10.1080/00397919508011411 | | Synthesis | To a solution of Dimethyl 2,6-pyridinedicarboxylate (10.0 g, 51.2 mmol) in MeOH (300 mL) was added KOH (2.89 g, 51.2 mmol) and themixture was stirred overnight at rt. After the removal of the solvent, the residue was diluted with water. Theaqueous layer was washed with AcOEt and acidified with conc. HCl aq, and then the mixture was extracted withthe solution of CHCl3/isopropanol (3/1 (v/v)). The organic layer were dried over MgSO4 and concentrated invacuo to give 2,6-Pyridinedicarboxylic acid monomethyl ester (8.17 g, 87 percent) as a white solid.
|
| | 2,6-Pyridinedicarboxylic acid monomethyl ester Preparation Products And Raw materials |
|