|
|
| | N-Methyl-1-(methylthio)-2-nitroethylen-1-amine Basic information |
| | N-Methyl-1-(methylthio)-2-nitroethylen-1-amine Chemical Properties |
| Melting point | 112-118 °C (lit.) | | Boiling point | 236.5±35.0 °C(Predicted) | | density | 1.199±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | solubility | Chloroform, Methanol (Sparingly) | | pka | 0.86±0.70(Predicted) | | form | powder to crystal | | color | Light orange to Yellow to Green | | BRN | 2828017 | | InChI | InChI=1S/C4H8N2O2S/c1-5-4(9-2)3-6(7)8/h3,5H,1-2H3 | | InChIKey | YQFHPXZGXNYYLD-UHFFFAOYSA-N | | SMILES | C(NC)(SC)=C[N+]([O-])=O | | CAS DataBase Reference | 61832-41-5(CAS DataBase Reference) | | NIST Chemistry Reference | Ethenamine, n-methyl-1-(methylthio)-2-nitro-(61832-41-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | RIDADR | UN 3335 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29309090 |
| | N-Methyl-1-(methylthio)-2-nitroethylen-1-amine Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | Intermediate in the preparation of Ranitidine and Nizatidine. | | Uses | (E) N-methyl-1-(methylthio)-2-nitroethenamine) (NMSM) may be used for the following syntheses:
- pyrano[2,3-c]pyrazol-6-amines
- 6-methoxy-N-methyl-3-nitro-4-nitromethyl-4H-chromen-2-amine
|
| | N-Methyl-1-(methylthio)-2-nitroethylen-1-amine Preparation Products And Raw materials |
|