| Company Name: |
TargetMol |
| Tel: |
400-821-0310 15002144251 |
| Email: |
xuexiang.shao@tsbiochem.com |
|
| | 1-(3,4-dihydroxyphenyl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylethanone Basic information |
| | 1-(3,4-dihydroxyphenyl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylethanone Chemical Properties |
| Boiling point | 649.7±65.0 °C(Predicted) | | density | 1.45±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 2mg/mL, clear | | pka | 7.48±0.20(Predicted) | | form | powder | | color | white to beige | | InChIKey | MVIWFFDPSPYDKQ-UHFFFAOYSA-N | | SMILES | CC1=CC=C(C=C1)N2C(SCC(C3=CC(O)=C(C=C3)O)=O)=NN=N2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1-(3,4-dihydroxyphenyl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylethanone Usage And Synthesis |
| Biological Activity | SNI-1 is an inhibitor of CARP-1(CCAR1)-NEMO (NF-KB essential modulator) interaction th at binds to CARP-1. SNI-1 inhibits chemotherapy-dependent canonical NF-KB signaling and attenuates secretion of the pro-inflammatory cytokines TNFα, IL-1β, and IL-8. It potentiates chemotherapeutic effects of DNA damaging agents such as Cisplatin and Adriamycin (doxorubicin) in several cancer cell lines including human triple-negative breast cancer (TNBC). |
| | 1-(3,4-dihydroxyphenyl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylethanone Preparation Products And Raw materials |
|