Methyltetrazine-PEG8-NHS ester manufacturers
|
| | Methyltetrazine-PEG8-NHS ester Basic information |
| Product Name: | Methyltetrazine-PEG8-NHS ester | | Synonyms: | Methyltetrazine-PEG8-NHS ester;Propanoic acid, 3-[[23-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenoxy]-3,6,9,12,15,18,21-heptaoxatricos-1-yl]oxy]-, 2,5-dioxo-1-pyrrolidinyl ester;2,5-dioxopyrrolidin-1-yl 1-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenoxy]-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oate | | CAS: | 2183440-34-6 | | MF: | C32H47N5O13 | | MW: | 709.74 | | EINECS: | | | Product Categories: | | | Mol File: | 2183440-34-6.mol |  |
| | Methyltetrazine-PEG8-NHS ester Chemical Properties |
| Boiling point | 790.6±70.0 °C(Predicted) | | density | 1.29±0.1 g/cm3(Predicted) | | pka | 1.67±0.10(Predicted) | | InChIKey | HBEBYIRKMRTDSK-UHFFFAOYSA-N | | SMILES | C(ON1C(=O)CCC1=O)(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOC1=CC=C(C2=NN=C(C)N=N2)C=C1 |
| | Methyltetrazine-PEG8-NHS ester Usage And Synthesis |
| Description | Methyltetrazine-PEG8-NHS Ester is a PEG active NHS ester, which is very reactive with amine(NH2) cotaining entity. The hydrophilic PEG spacer is transferrable to the labeled molecule, reducing aggregation of labeled proteins stored in solution. Methyltetrazine enable click chemistry with TCO (trans-cycloctene). | | Uses | Methyltetrazine-PEG8-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. | | IC 50 | PEGs | | References | [1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 DOI:10.1016/j.ebiom.2018.09.005 |
| | Methyltetrazine-PEG8-NHS ester Preparation Products And Raw materials |
|