| Company Name: |
Amatek Scientific Co. Ltd.
|
| Tel: |
0512-56316828 |
| Email: |
info@amateksci.com |
| Products Intro: |
Product Name:BocNH-PEG2-CH2CH2COONHS
CAS:2183440-73-3
Purity:97% HPLC Package:1g;5g;25g;100g
|
| Company Name: |
Xi'an Confluore Biological Technology Co., Ltd.
|
| Tel: |
+86-156-80926068 +86-15680926068 |
| Email: |
1924344760@qq.com |
| Products Intro: |
Product Name:t-Boc-N-amido-PEG2-NHS ester
CAS:2183440-73-3
Purity:98% HPLC Package:10MG;25MG;50MG;100MG;1G;5G Remarks:For customers outside China,please use the website:www.confluore.com
|
t-Boc-N-amido-PEG2-NHS ester manufacturers
|
| | t-Boc-N-amido-PEG2-NHS ester Basic information |
| Product Name: | t-Boc-N-amido-PEG2-NHS ester | | Synonyms: | t-Boc-N-amido-PEG2-NHS ester;Boc-NH-PEG2-C2-NHS ester;4,7,12-Trioxa-10-azatetradecanoic acid, 13,13-dimethyl-11-oxo-, 2,5-dioxo-1-pyrrolidinyl ester;2,5-Dioxopyrrolidin-1-yl 2,2-dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oate;BocNH-PEG2-CH2CH2COONHS;BocNH-PEG2-CH2CH2COONHS/4,7,12-Trioxa-10-azatetradecanoic acid, 13,13-dimethyl-11-oxo-, 2,5-dioxo-1-pyrrolidinyl ester | | CAS: | 2183440-73-3 | | MF: | C16H26N2O8 | | MW: | 374.39 | | EINECS: | | | Product Categories: | | | Mol File: | 2183440-73-3.mol |  |
| | t-Boc-N-amido-PEG2-NHS ester Chemical Properties |
| density | 1.24±0.1 g/cm3(Predicted) | | solubility | Soluble in DCM | | pka | 12.22±0.46(Predicted) | | InChI | InChI=1S/C16H26N2O8/c1-16(2,3)25-15(22)17-7-9-24-11-10-23-8-6-14(21)26-18-12(19)4-5-13(18)20/h4-11H2,1-3H3,(H,17,22) | | InChIKey | FNZXIPYAXFROBS-UHFFFAOYSA-N | | SMILES | C(ON1C(=O)CCC1=O)(=O)CCOCCOCCNC(=O)OC(C)(C)C |
| | t-Boc-N-amido-PEG2-NHS ester Usage And Synthesis |
| Description | t-Boc-N-amido-PEG2-NHS ester is a PEG linker containing an NHS ester and a t-Boc protected amine group. The hydrophilic PEG spacer increases the solubility of compounds in aqueous media. The t-Boc group can be deprotected under mild acidic conditions to form a free amine. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. |
| | t-Boc-N-amido-PEG2-NHS ester Preparation Products And Raw materials |
|