|
|
| | 3,6-Dichloro-1,2-benzenedithiol Basic information |
| Product Name: | 3,6-Dichloro-1,2-benzenedithiol | | Synonyms: | 3 6-DICHLORO-1 2-BENZENEDITHIOL 95;3 6-DICHLORO-1 2-BENZENEDITHIOL 95%;3,6-DICHLORO-BENZENE-1,2-DITHIOL;1,2-Benzenedithiol, 3,6-dichloro-;3,6-Dichloro-1,2-benzenedithiol | | CAS: | 87314-49-6 | | MF: | C6H4Cl2S2 | | MW: | 211.13 | | EINECS: | | | Product Categories: | | | Mol File: | 87314-49-6.mol |  |
| | 3,6-Dichloro-1,2-benzenedithiol Chemical Properties |
| Melting point | 58-60°C (lit.) | | Boiling point | 314.9±37.0 °C(Predicted) | | density | 1.523±0.06 g/cm3(Predicted) | | pka | 4.40±0.50(Predicted) | | InChI | InChI=1S/C6H4Cl2S2/c7-3-1-2-4(8)6(10)5(3)9/h1-2,9-10H | | InChIKey | AJCUDWCLDWDLNY-UHFFFAOYSA-N | | SMILES | C1(S)=C(Cl)C=CC(Cl)=C1S |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | RIDADR | UN 3335 | | WGK Germany | 3 |
| | 3,6-Dichloro-1,2-benzenedithiol Usage And Synthesis |
| Uses | 3,6-Dichloro-1,2-benzenedithiol is a stain/dye. Dyes and metabolites. | | Application |
3,6-Dichloro-1,2-benzenedithiol has been used as a ligand in thiolate complexes and a series of homo-chalcogenide and mixed-chalcogenide ligand complexes. For example, Direct reaction between Cu(ClO4)2 and 3,6-dichloro-1,2-benzenedithiol (HSC6H2Cl2SH) in the presence of basic salts leads to a series of bis(dithiolato)cuprate(III) [Cu(SC6H2Cl2S)2]? coordination complexes and coordination polymers. In addition, One-pot reactions between Ni(II), Pd(II), or Pt(II) salts and 3,6-dichloro-1,2-benzenedithiol (HSC6H2Cl2SH) in KOH medium under argon lead to a series of bis-dithiolene coordination polymer[1-2].
| | References | [1] Amo-Ochoa, Pilar et al. “Copper dithiolene [Cu(SC6H2Cl2S)2]? units connected to alkaline/copper complexes: from ionic assemblies to discrete molecular entities and coordination polymers?.” CrystEngComm 6 (2018): 957–963.
[2] Delgado, Esther et al. “Unprecedented layered coordination polymers of dithiolene group 10 metals: magnetic and electrical properties?.” Dalton Transactions 15 (2016): 6696–6701. |
| | 3,6-Dichloro-1,2-benzenedithiol Preparation Products And Raw materials |
|