|
| 3,6-Dichloro-1,2-benzenedithiol Basic information |
Product Name: | 3,6-Dichloro-1,2-benzenedithiol | Synonyms: | 3 6-DICHLORO-1 2-BENZENEDITHIOL 95;3 6-DICHLORO-1 2-BENZENEDITHIOL 95%;3,6-DICHLORO-BENZENE-1,2-DITHIOL;1,2-Benzenedithiol, 3,6-dichloro-;3,6-Dichloro-1,2-benzenedithiol | CAS: | 87314-49-6 | MF: | C6H4Cl2S2 | MW: | 211.13 | EINECS: | | Product Categories: | | Mol File: | 87314-49-6.mol | |
| 3,6-Dichloro-1,2-benzenedithiol Chemical Properties |
Melting point | 58-60°C (lit.) | Boiling point | 314.9±37.0 °C(Predicted) | density | 1.523±0.06 g/cm3(Predicted) | pka | 4.40±0.50(Predicted) | InChI | InChI=1S/C6H4Cl2S2/c7-3-1-2-4(8)6(10)5(3)9/h1-2,9-10H | InChIKey | AJCUDWCLDWDLNY-UHFFFAOYSA-N | SMILES | C1(S)=C(Cl)C=CC(Cl)=C1S |
Hazard Codes | Xi | Risk Statements | 36/37/38 | Safety Statements | 26 | RIDADR | UN 3335 | WGK Germany | 3 |
| 3,6-Dichloro-1,2-benzenedithiol Usage And Synthesis |
Uses | 3,6-Dichloro-1,2-benzenedithiol is a stain/dye. Dyes and metabolites. | Application |
3,6-Dichloro-1,2-benzenedithiol has been used as a ligand in thiolate complexes and a series of homo-chalcogenide and mixed-chalcogenide ligand complexes. For example, Direct reaction between Cu(ClO4)2 and 3,6-dichloro-1,2-benzenedithiol (HSC6H2Cl2SH) in the presence of basic salts leads to a series of bis(dithiolato)cuprate(III) [Cu(SC6H2Cl2S)2]? coordination complexes and coordination polymers. In addition, One-pot reactions between Ni(II), Pd(II), or Pt(II) salts and 3,6-dichloro-1,2-benzenedithiol (HSC6H2Cl2SH) in KOH medium under argon lead to a series of bis-dithiolene coordination polymer[1-2].
| References | [1] Amo-Ochoa, Pilar et al. “Copper dithiolene [Cu(SC6H2Cl2S)2]? units connected to alkaline/copper complexes: from ionic assemblies to discrete molecular entities and coordination polymers?.” CrystEngComm 6 (2018): 957–963. [2] Delgado, Esther et al. “Unprecedented layered coordination polymers of dithiolene group 10 metals: magnetic and electrical properties?.” Dalton Transactions 15 (2016): 6696–6701. |
| 3,6-Dichloro-1,2-benzenedithiol Preparation Products And Raw materials |
|