|
| 2-Bromopropionyl chloride Basic information | Uses |
| 2-Bromopropionyl chloride Chemical Properties |
Boiling point | 131-133 °C (lit.) | density | 1.7 g/mL at 25 °C (lit.) | refractive index | n20/D 1.477(lit.) | Fp | 125 °F | storage temp. | Store at RT. | form | Liquid | color | Clear yellow | Water Solubility | REACTS | BRN | 773800 | InChI | InChI=1S/C3H4BrClO/c1-2(4)3(5)6/h2H,1H3 | InChIKey | OZGMODDEIHYPRY-UHFFFAOYSA-N | SMILES | C(Cl)(=O)C(Br)C | CAS DataBase Reference | 7148-74-5(CAS DataBase Reference) | NIST Chemistry Reference | 2-Bromopropionyl chloride(7148-74-5) |
| 2-Bromopropionyl chloride Usage And Synthesis |
Uses | 2-Bromopropionyl chloride is a reagent that is used in the preparation of pyrazinecarboxamide-based inhibitors of diacylglycerol acyltransferase 1. | Chemical Properties | clear yellow liquid | Uses | 2-Bromopropionyl chloride was used to synthesize cellulose macroinitiator for homogeneous atom transfer radical polymerization. It was used in the synthesis of 2-aminopropionyl polystyrene resin by Friedel Crafts reaction. |
| 2-Bromopropionyl chloride Preparation Products And Raw materials |
|