|
| 1-O-BENZYL-RAC-GLYCEROL Basic information |
| 1-O-BENZYL-RAC-GLYCEROL Chemical Properties |
Melting point | 25-29 °C(lit.) | Boiling point | 140-145 | alpha | 5.5o (C=20 IN CHLOROFORM) | density | 1.140 g/mL at 20 °C(lit.) | refractive index | n20/D 1.533 | Fp | >230 °F | storage temp. | 2-8°C | form | clear liquid | pka | 13.65±0.20(Predicted) | color | Colorless to Light yellow | Optical Rotation | [α]20/D +5.5°, c = 20 in chloroform | BRN | 2048922 | Stability: | Stable, but moisture sensitive. Incompatible with strong oxidizing agents. | InChI | InChI=1S/C10H14O3/c11-6-10(12)8-13-7-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2/t10-/m1/s1 | InChIKey | LWCIBYRXSHRIAP-SNVBAGLBSA-N | SMILES | C(O)[C@@H](O)COCC1=CC=CC=C1 | CAS DataBase Reference | 56552-80-8(CAS DataBase Reference) |
Safety Statements | 22-24/25 | WGK Germany | 3 | RTECS | TY3180000 | F | 3-9 | HS Code | 2909498090 |
| 1-O-BENZYL-RAC-GLYCEROL Usage And Synthesis |
Chemical Properties | colourless crystalline solid | Uses | Employed in the synthesis of a cyclopropyl chiron used in the preparation of 2,3-methanoamino acids. Chiral building block in the synthesis of petrosynes and biologically important phospholipid analogs. |
| 1-O-BENZYL-RAC-GLYCEROL Preparation Products And Raw materials |
|