|
|
| | Dicarbonylacetylacetonato rhodium(I) Basic information | | Reaction |
| | Dicarbonylacetylacetonato rhodium(I) Chemical Properties |
| Melting point | 154-156 °C (lit.) | | density | 1.96[at 20℃] | | vapor pressure | 0.13Pa at 25℃ | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Soluble in acetone | | form | Needles or Flakes | | color | Greenish-red | | Water Solubility | insoluble | | Exposure limits | ACGIH: TWA 1 mg/m3
NIOSH: IDLH 100 mg/m3; TWA 0.1 mg/m3 | | InChI | InChI=1S/C5H7O2.2CO.Rh/c1-4(6)3-5(2)7;2*1-2;/h3H,1-2H3;;;/q-1;;;+1 | | InChIKey | QKXHARLOMLGJCF-UHFFFAOYSA-N | | SMILES | C([Rh+]1(O=C(C)[CH-]C(C)=O1)C#O)#O | | LogP | 0.4 at 20℃ | | NIST Chemistry Reference | Rhodium, dicarbonyl(2,4-pentanedionato-o,o')-, (sp-4-2)-(14874-82-9) | | EPA Substance Registry System | Rhodium, dicarbonyl(2,4-pentanedionato-.kappa.O2,.kappa.O4)-, (SP-4-2)- (14874-82-9) |
| | Dicarbonylacetylacetonato rhodium(I) Usage And Synthesis |
| Reaction |
- Precatalyst for hydroformylation of olefins.
- Precatalyst for silylformylation of olefins.
- Precatalyst for carbonylative silylcarbo-cyclization in the syntheses of isodomoic acids.
- Precatalyst for the conjugate addition of aryl- and alkenylboronic acids to enones.
| | Chemical Properties | Red/Green Crystalline Powder | | Uses | Umicore Precatalysts for Asymmetric and Cross-Coupling Catalysis
Catalyst for various carbonylation reactions, silylcarbocyclizations,conjugate additions to enones, carbamoylstannation,and reduction of aromatic nitro compounds | | Uses | Employed in in situ formation of a fluorous-soluble hydroformylation catalyst of interest in molecular engineering. | | Uses | (Acetylacetonato)dicarbonylrhodium(I) is used in in situ formation of a floors-soluble hydroformylation catalyst of interest in molecular engineering. It is also used as a catalyst for various carbonylation reactions, silylcarbocyclizations, conjugate additions to eons, carbamoylstannation, and reduction of aromatic nitro compounds. It is also used in Hydroformylation reaction. | | Flammability and Explosibility | Flammable | | reaction suitability | reagent type: catalyst |
| | Dicarbonylacetylacetonato rhodium(I) Preparation Products And Raw materials |
|