|
|
| | 1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-ol Basic information | | Uses |
| Product Name: | 1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-ol | | Synonyms: | 5-HYDROXY-1-METHYL-3-TRIFLUOROMETHYL-1H-PYRAZOLE;5-HYDROXY-1-METHYL-3-(TRIFLUOROMETHYL)PYRAZOLE;3-(TRIFLUOROMETHYL)-1-METHYL-1H-PYRAZOL-5-OL;1-METHYL-3-(TRIFLUOROMETHYL)-1H-PYRAZOL-5-OL;5-Hydroxy-1-methyl-3-trifluoromethyl-1H-pyrazole, 99+%;2-METHYL-3-HYDROXY-5-TRIFLUOROMETHYLPYRAZOLE;1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-ol, 2-Methyl-5-(trifluoromethyl)-2H-pyrazol-3-ol;5-Hydroxy-1-Methyl-3-trifluoroMethyl-1H-pyrazole, 99+% 1GR | | CAS: | 122431-37-2 | | MF: | C5H5F3N2O | | MW: | 166.1 | | EINECS: | 626-417-3 | | Product Categories: | Building Blocks;Pyrazole;122431-37-2;top | | Mol File: | 122431-37-2.mol |  |
| | 1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-ol Chemical Properties |
| Melting point | 177-179 °C | | Boiling point | 224.4±35.0 °C(Predicted) | | density | 1.50±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Crystalline Powder or Needles | | pka | 8.08±0.28(Predicted) | | color | Light yellow | | InChI | InChI=1S/C5H5F3N2O/c1-10-4(11)2-3(9-10)5(6,7)8/h2,11H,1H3 | | InChIKey | UGVAQFVQIHNCJV-UHFFFAOYSA-N | | SMILES | N1(C)C(O)=CC(C(F)(F)F)=N1 | | NIST Chemistry Reference | 1-Methyl-3-trifluoromethyl-2-pyrazolin-5-one(122431-37-2) |
| Hazard Codes | Xi,T | | Risk Statements | 36/37/38-25 | | Safety Statements | 24/25-45-26 | | RIDADR | UN 2811 6.1 / PGIII | | HazardClass | IRRITANT | | HS Code | 29331990 |
| Provider | Language |
|
ACROS
| English |
| | 1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-ol Usage And Synthesis |
| Uses | 5-Hydroxy-1-methyl-3-trifluoromethyl-1H-pyrazole is a biologically active pyrazole organic compound with potential anti-inflammatory, antitumor, and antibacterial properties, making it an important candidate compound for drug development. This compound can also be used as an active ingredient in pesticides to control various crop diseases and pests. | | Chemical Properties | light yellow crystalline powder or needles |
| | 1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-ol Preparation Products And Raw materials |
|