|
| 3,4-Dimethylphenylhydrazine hydrochloride Basic information |
Product Name: | 3,4-Dimethylphenylhydrazine hydrochloride | Synonyms: | LABOTEST-BB LT01148173;3,4-DIMETHYLPHENYLHYDRAZINE HYDROCHLORIDE;3,4-DIMETHYLPHENYLHYDRAZINE HCL;3,4-DiMethylphenylhy;(3,4-dimethylphenyl)-Hydrazine hydrochloride (1:);(3,4-Dimethylphenyl)hydrazine xhydrochloride | CAS: | 86746-50-1 | MF: | C8H13ClN2 | MW: | 172.66 | EINECS: | | Product Categories: | | Mol File: | 86746-50-1.mol |  |
| 3,4-Dimethylphenylhydrazine hydrochloride Chemical Properties |
Melting point | 195-200 °C(lit.) | InChI | InChI=1S/C8H12N2.ClH/c1-6-3-4-8(10-9)5-7(6)2;/h3-5,10H,9H2,1-2H3;1H | InChIKey | YYMIOVAEQIEPET-UHFFFAOYSA-N | SMILES | N(C1=CC=C(C)C(C)=C1)N.[H]Cl | CAS DataBase Reference | 86746-50-1(CAS DataBase Reference) |
Hazard Codes | Xi | Risk Statements | 36/37/38 | Safety Statements | 26-36 | WGK Germany | 3 |
| 3,4-Dimethylphenylhydrazine hydrochloride Usage And Synthesis |
| 3,4-Dimethylphenylhydrazine hydrochloride Preparation Products And Raw materials |
|