|
|
| | N-(4-Methoxybenzyl)-N-methylamine Basic information |
| Product Name: | N-(4-Methoxybenzyl)-N-methylamine | | Synonyms: | AKOS BC-0897;(4-METHOXY-BENZYL)-METHYL-AMINE;N-(4-METHOXYBENZYL)-N-METHYLAMINE;N-Methyl-4-methoxybenzylamine;4-METHOXY-N-METHYLBENZYLAMINE 95%;(4-methoxyphenyl)-N-methylmethanamine;4-Methoxy-N-methylbenzylamine ,97%;N-(4-Methoxybenzyl)-N-methylamine ,97% | | CAS: | 702-24-9 | | MF: | C9H13NO | | MW: | 151.21 | | EINECS: | 200-002-4 | | Product Categories: | Amines and Anilines | | Mol File: | 702-24-9.mol |  |
| | N-(4-Methoxybenzyl)-N-methylamine Chemical Properties |
| Melting point | 238 °C | | Boiling point | 88 °C | | density | 1.008 g/mL at 25 °C | | refractive index | n20/D1.529 | | Fp | 109℃ | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | pka | 10.14±0.10(Predicted) | | color | Clear Beige | | InChI | InChI=1S/C9H13NO/c1-10-7-8-3-5-9(11-2)6-4-8/h3-6,10H,7H2,1-2H3 | | InChIKey | AIJFPNKGGAPZFJ-UHFFFAOYSA-N | | SMILES | C1(CNC)=CC=C(OC)C=C1 | | CAS DataBase Reference | 702-24-9(CAS DataBase Reference) |
| Hazard Codes | C,Xn | | Risk Statements | 36/37/38-34-22 | | Safety Statements | 26-36/37/39 | | RIDADR | UN 2735 8/PG III | | WGK Germany | 1 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2921490090 |
| | N-(4-Methoxybenzyl)-N-methylamine Usage And Synthesis |
| Uses | N-(4-Methoxybenzyl)-N-methylamine is used in the synthetic preparation of many types of compounds, including the synthesis of trifluoromethyl-sulfonimidamides from sulfinamides as well as the preparation of piperazinylquinazoline amine compounds as toll-like receptor 9 signaling antagonists for treatment of immune disorders. |
| | N-(4-Methoxybenzyl)-N-methylamine Preparation Products And Raw materials |
|