|
|
| | 2,4,6-Trimethylbenzoyl chloride Basic information |
| Product Name: | 2,4,6-Trimethylbenzoyl chloride | | Synonyms: | 2,4,6-Trimethylbenzoyl cloride;Mesitylcarbonylchloride;2,4,6-TRIMETHYLBENZOYL CHLORIDE;MESITOYL CHLORIDE;BENZOYL CHLORIDE, 2,4,6-TRIMETHYL-;TMBC;2,4,6-Trimethylbenzoyl chloride, 98+%;Benzoyl chloride, 2,4,6-trimethyl- (6CI,7CI,8CI,9CI) | | CAS: | 938-18-1 | | MF: | C10H11ClO | | MW: | 182.65 | | EINECS: | 213-339-6 | | Product Categories: | ACIDHALIDE;API intermediates;Acid Halides;Carbonyl Compounds;Organic Building Blocks;bc0001 | | Mol File: | 938-18-1.mol |  |
| | 2,4,6-Trimethylbenzoyl chloride Chemical Properties |
| Boiling point | 143-146 °C (60 mmHg) | | density | 1.095 g/mL at 25 °C | | vapor pressure | 1.52Pa at 25℃ | | refractive index | 1.528-1.53 | | Fp | 143-146°C/60mm | | storage temp. | 2-8°C | | form | Liquid | | color | Clear light yellow | | Water Solubility | Reacts slowly with water. | | Sensitive | Moisture Sensitive | | BRN | 776108 | | InChI | InChI=1S/C10H11ClO/c1-6-4-7(2)9(10(11)12)8(3)5-6/h4-5H,1-3H3 | | InChIKey | UKRQMDIFLKHCRO-UHFFFAOYSA-N | | SMILES | C(Cl)(=O)C1=C(C)C=C(C)C=C1C | | LogP | 2.42-3.65 at 25℃ | | CAS DataBase Reference | 938-18-1(CAS DataBase Reference) | | NIST Chemistry Reference | 2,4,6-Trimethylbenzoyl chloride(938-18-1) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 45-36/37/39-26 | | RIDADR | 1760 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29163990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2,4,6-Trimethylbenzoyl chloride Usage And Synthesis |
| Description | 2,4,6-Trimethylbenzoyl chloride is an important organic reagent that can be used for the electrochemical reduction reaction to prepare 2,4,6-trimethylbenzaldehyde and tetramer (i.e. 1,2-bis(2,4,6-trimethylphenyl)ethylene-1,2-diol bis(2,4,6-trimethylbenzoate))[1]. | | Chemical Properties | clear light yellow liquid | | Uses | 2,4,6-Trimethylbenzoyl chloride is used, in the presence of pyridine, to protect OH groups as mesitoate esters. | | References | [1] GREG A. UROVE D. P. Electrochemical reduction of 2,4,6-trimethylbenzoyl chloride and 2,4,6-trimethylbenzaldehyde at carbon and mercury cathodes in acetonitrile[J]. Electrochimica Acta, 1994, 39 1: 1441-1450. DOI:10.1016/0013-4686(94)85056-9. |
| | 2,4,6-Trimethylbenzoyl chloride Preparation Products And Raw materials |
|