|
|
| | Thianaphthene-2-carboxylic acid Basic information |
| | Thianaphthene-2-carboxylic acid Chemical Properties |
| Melting point | 241-244 °C (lit.) | | Boiling point | 280.44°C (rough estimate) | | density | 1.3242 (rough estimate) | | refractive index | 1.5480 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 3.48±0.30(Predicted) | | color | White to Light yellow | | Water Solubility | Soluble in ethanol, acetone and chloroform. Insoluble in water. | | Merck | 14,9345 | | BRN | 124613 | | InChI | InChI=1S/C9H6O2S/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5H,(H,10,11) | | InChIKey | DYSJMQABFPKAQM-UHFFFAOYSA-N | | SMILES | C12=CC=CC=C1C=C(C(O)=O)S2 | | CAS DataBase Reference | 6314-28-9(CAS DataBase Reference) | | NIST Chemistry Reference | Thianaphthene-2-carboxylic acid(6314-28-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Thianaphthene-2-carboxylic acid Usage And Synthesis |
| Chemical Properties | off-white to yellowish-beige crystalline powder | | Uses | Thianaphthene-2-carboxylic acid may be used for the fabrication of carboxylated conducting polymer/CNTs (carbon nanotubes) composites thin films. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 21, p. 39, 1956 DOI: 10.1021/jo01107a007 | | General Description | Thianaphthene-2-carboxylic acid, a benzothiophene, is a heterocyclic sulfur compound. It undergoes degradation (23%) by employing a mixture of washed cells of Rhodococcus erythropolis DS-3 and Gordonia sp. C-6. |
| | Thianaphthene-2-carboxylic acid Preparation Products And Raw materials |
|