|
|
| | Uridine-5'-triphosphoric acid trisodium salt Basic information |
| | Uridine-5'-triphosphoric acid trisodium salt Chemical Properties |
| Melting point | 140 °C | | Fp | 113 °C | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | H2O: soluble25 mg of UTP in 0.5 ml of solvent, clear, colorless | | form | Powder | | color | White | | Water Solubility | 75 g/100 mL (20 ºC) | | BRN | 3585234 | | InChIKey | IKVGSWYKOMJBSB-RFFBCSJBNA-N | | SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O[C@H]1N1C=CC(=O)NC1=O)O.[NaH] |&1:1,2,3,19,r| | | CAS DataBase Reference | 19817-92-6(CAS DataBase Reference) |
| | Uridine-5'-triphosphoric acid trisodium salt Usage And Synthesis |
| Description | Uridine-5'-triphosphoric acid trisodium salt, also known as UTP, is a polyphosphate analogue of uridine that is used in the synthesis of agonists at the G-protein-coupled P2Y receptors. | | Chemical Properties | White crystalline powder | | Uses | Uridine-5'-triphosphoric acid trisodium salt is a polyphosphate analogue of the nucleoside uridine used in the preparation of potent and selective agonists at the G-protein-coupled P2Y receptors. | | Uses | P2Y receptor agonist. | | Uses | psychostimulant | | Biochem/physiol Actions | Uridine-5′-Triphosphate?(UTP) is a cytosolic nucleotide component of nucleic acids. It serves as a signaling molecule in the extracellular space. Uridine-5′-Triphosphate?(UTP) is involved in various pathophysiological responses in the nervous system.?UTP also plays a major role in the regeneration process. |
| | Uridine-5'-triphosphoric acid trisodium salt Preparation Products And Raw materials |
|