1-(2-methoxy-1-methylethoxy)propan-2-ol manufacturers
- PPG-2 methyl ether
-
- $230.00 / 1g
-
2026-01-10
- CAS:20324-32-7
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 500kg
|
| | 1-(2-methoxy-1-methylethoxy)propan-2-ol Basic information |
| Product Name: | 1-(2-methoxy-1-methylethoxy)propan-2-ol | | Synonyms: | 1-(2-methoxy-1-methylethoxy)propan-2-ol;1-(2-METHOXY)PROPANOL-2;2-PROPANOL,1-(2-METHOXY-1-MET;diisopropylene glycol monomethyl ether;(2-Hydroxypropyl)(1-methyl-3-oxabutane-1-yl) ether;1,4-Dimethyl-3,6-dioxaheptane-1-ol;5-Methyl-4,7-dioxaoctane-2-ol;6-Methoxy-5-methyl-4-oxahexane-2-ol | | CAS: | 20324-32-7 | | MF: | C7H16O3 | | MW: | 148.2 | | EINECS: | 2437333 | | Product Categories: | | | Mol File: | 20324-32-7.mol |  |
| | 1-(2-methoxy-1-methylethoxy)propan-2-ol Chemical Properties |
| Boiling point | 76-78 °C(Press: 10 Torr) | | density | 0.955±0.06 g/cm3(Predicted) | | pka | 14.41±0.20(Predicted) | | InChI | InChI=1S/C7H16O3/c1-6(8)4-10-7(2)5-9-3/h6-8H,4-5H2,1-3H3 | | InChIKey | WGYZMNBUZFHYRX-UHFFFAOYSA-N | | SMILES | C(OC(C)COC)C(O)C | | EPA Substance Registry System | 1-(2-Methoxy-1-methylethoxy)-2-propanol (20324-32-7) |
| | 1-(2-methoxy-1-methylethoxy)propan-2-ol Usage And Synthesis |
| Uses | 1-(2-methoxy-1-methylethoxy)propan-2-ol (PPG-2 methyl ether) is an organic intermediate component. It can be used in a wide range of chemical products or cosmetic solvents, paint and coating additives, viscosity modifiers, surfactants, detergents and corrosion inhibitors, etc. |
| | 1-(2-methoxy-1-methylethoxy)propan-2-ol Preparation Products And Raw materials |
|