|
|
| | 2-Bromo-4-methylthiazole Basic information |
| | 2-Bromo-4-methylthiazole Chemical Properties |
| Boiling point | 90 °C(Press: 25 Torr) | | density | 1.654 g/mL at 25 °C | | refractive index | n20/D 1.572 | | Fp | 90°C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 1.36±0.10(Predicted) | | form | Oil | | color | Colourless | | Sensitive | Stench | | InChI | InChI=1S/C4H4BrNS/c1-3-2-7-4(5)6-3/h2H,1H3 | | InChIKey | KLFWJAAGXUDNIS-UHFFFAOYSA-N | | SMILES | S1C=C(C)N=C1Br |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-37/38-41 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 29349990 |
| | 2-Bromo-4-methylthiazole Usage And Synthesis |
| Chemical Properties | Clear light red liquid | | Uses | 2-Bromo-4-methylthiazole is a useful reagent for preparing galactoside inhibitor of galectins. |
| | 2-Bromo-4-methylthiazole Preparation Products And Raw materials |
|