| Company Name: |
Shanghai Chaolan Chemical Technology Center
|
| Tel: |
QQ:65489617 15618227136 |
| Email: |
info@SuperLan-chem.com |
| Products Intro: |
Product Name:(2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-5-yl)glycine
CAS:2412056-27-8
Purity:98% HPLC Package:5MG;10MG;50MG;100MG,1G,5G,500G
|
| Company Name: |
Jilin Province Woda Biotechnology Co., Ltd.
|
| Tel: |
13504435624 |
| Email: |
1927928688@qq.com |
| Products Intro: |
Product Name:(2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-5-yl)glycine
CAS:2412056-27-8
Purity:98+ Package:1g/
|
|
| | (2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-5-yl)glycine Basic information |
| Product Name: | (2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-5-yl)glycine | | Synonyms: | (2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-5-yl)glycine;Thalidomide-5-NH2-CH2-COOH;inhibit,cancer,Thalidomide,E3 ligase,inflammatory,infectious,Thalidomide-5-NH-2-CH2-COOH,trk,Thalidomide5NH2CH2COOH,Inhibitor,tropomyosin receptor kinase,E3 ligase-recruiting Moiety,neurodegenerative,Thalidomide 5 NH2 CH2 COOH,selective,Ligands for E3 Ligase | | CAS: | 2412056-27-8 | | MF: | C15H13N3O6 | | MW: | 331.28 | | EINECS: | | | Product Categories: | | | Mol File: | 2412056-27-8.mol |  |
| | (2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-5-yl)glycine Chemical Properties |
| solubility | DMSO : 33.33 mg/mL (100.61 mM; Need ultrasonic) | | InChI | InChI=1S/C15H13N3O6/c19-11-4-3-10(13(22)17-11)18-14(23)8-2-1-7(16-6-12(20)21)5-9(8)15(18)24/h1-2,5,10,16H,3-4,6H2,(H,20,21)(H,17,19,22) | | InChIKey | ZATMCTCUKSYXHM-UHFFFAOYSA-N | | SMILES | O=C1C2=CC(NCC(=O)O)=CC=C2C(=O)N1C1CCC(=O)NC1=O |
| | (2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-5-yl)glycine Usage And Synthesis |
| Biological Activity | Thalidomide-5-NH2-CH2-COOH (compound 114) is a potent and selective inhibitor of tropomyosin receptor kinase (trk). Thalidomide-5-NH2-CH2-COOH is a ligand of E3 ligase. Thalidomide-5-NH2-CH2-COOH has the potential for researching one or more diseases (extracted from patent WO2021170109A1)[1]. | | References | [1]. Jing Liu, et al. Tropomyosin receptor kinase (trk) degradation compounds and methods of use. Patent WO2021170109A1. |
| | (2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-5-yl)glycine Preparation Products And Raw materials |
|