| Company Name: |
Shenzhen Roark Pharma-Tec Co., Ltd. Gold
|
| Tel: |
13128912434 |
| Email: |
2880126944@qq.com |
| Products Intro: |
Product Name:Ritonavir Impurity 30
CAS:2519851-81-9
Purity:98% HPLC Package:10MG;25MG;50MG;100MG
|
| Company Name: |
ChemStrong Scientific Co.,Ltd
|
| Tel: |
0755-0755-66853366 13670046396 |
| Email: |
sales@chem-strong.com |
| Products Intro: |
Product Name:Ritonavir Impurity 25
CAS:2519851-81-9
Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
|
| | L-Valine, N-[[[[2-(1-hydroxy-1-methylethyl)-4-thiazolyl]methyl]methylamino]carbonyl]- Basic information |
| | L-Valine, N-[[[[2-(1-hydroxy-1-methylethyl)-4-thiazolyl]methyl]methylamino]carbonyl]- Chemical Properties |
| Boiling point | 574.2±50.0 °C(Predicted) | | density | 1.265±0.06 g/cm3(Predicted) | | solubility | soluble in Methanol | | form | Solid | | pka | 4.39±0.10(Predicted) | | color | Off White | | InChI | InChI=1/C14H23N3O4S/c1-8(2)10(11(18)19)16-13(20)17(5)6-9-7-22-12(15-9)14(3,4)21/h7-8,10,21H,6H2,1-5H3,(H,16,20)(H,18,19)/t10-/s3 | | InChIKey | NZHBDVDFIJVUMR-JQHDBZEONA-N | | SMILES | C(C1=CSC(C(O)(C)C)=N1)N(C)C(=O)N[C@H](C(=O)O)C(C)C |&1:15,r| |
| | L-Valine, N-[[[[2-(1-hydroxy-1-methylethyl)-4-thiazolyl]methyl]methylamino]carbonyl]- Usage And Synthesis |
| Uses | (S)-2-(3-((2-(2-Hydroxypropan-2-yl)thiazol-4-yl)methyl)-3-methylureido)-3-methylbutanoic Acid is an intermediate in the synthesis of Ritonavir (R535000) derivatives. |
| | L-Valine, N-[[[[2-(1-hydroxy-1-methylethyl)-4-thiazolyl]methyl]methylamino]carbonyl]- Preparation Products And Raw materials |
|