|
|
| | (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxo-1-cyclohexenyl)nona-2,4,6,8-tetraenoic acid Basic information |
| Product Name: | (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxo-1-cyclohexenyl)nona-2,4,6,8-tetraenoic acid | | Synonyms: | (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxo-1-cyclohexenyl)nona-2,4,6,8-tetraenoic acid;all-trans 4-Keto Retinoic Acid;(E)-3,7-Dimethyl-9-(2,6,6-trimethyl-3-oxo-1-cyclohexen-1-yl)-2,4,6,8-nonatetraenoic acid;Retinoic acid, 4-oxo-;Ro 12-4824;Ro 11-4824;4-Oxo Tretinoin (4-Oxo Retinoic Acid);(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohex-1-enyl)nona-2,4,6,8-tetraenoic acid | | CAS: | 38030-57-8 | | MF: | C20H26O3 | | MW: | 314.42 | | EINECS: | | | Product Categories: | Metabolites & Impurities, Pharmaceuticals, Intermediates & Fine Chemicals;Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals;Retinoids | | Mol File: | 38030-57-8.mol |  |
| | (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxo-1-cyclohexenyl)nona-2,4,6,8-tetraenoic acid Chemical Properties |
| Melting point | 175-179 °C | | Boiling point | 509.9±29.0 °C(Predicted) | | density | 1.070±0.06 g/cm3(Predicted) | | storage temp. | Amber Vial, -20°C Freezer, Under Inert Atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.73±0.33(Predicted) | | color | Yellow to Dark Orange | | Stability: | Store Dry in Freezer at -20°C for up to 1 year; in Solution at -20°C for up to 3 Months. | | InChI | InChI=1S/C20H26O3/c1-14(7-6-8-15(2)13-19(22)23)9-10-17-16(3)18(21)11-12-20(17,4)5/h6-10,13H,11-12H2,1-5H3,(H,22,23)/b8-6+,10-9+,14-7+,15-13+ | | InChIKey | GGCUJPCCTQNTJF-FRCNGJHJSA-N | | SMILES | C(O)(=O)/C=C(/C=C/C=C(/C=C/C1C(C)(C)CCC(=O)C=1C)\C)\C |
| | (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxo-1-cyclohexenyl)nona-2,4,6,8-tetraenoic acid Usage And Synthesis |
| Chemical Properties | Orange Solid | | Uses | A metabolite of all-trans-Retinoic Acid, a ligand for both the retinoic acid receptor (RAR) and the retinoid X receptor (RXR). | | Definition | ChEBI: A retinoid that consists of all-trans-retinoic acid bearing an oxo substituent at position 4 on the cyclohexenyl ring. |
| | (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxo-1-cyclohexenyl)nona-2,4,6,8-tetraenoic acid Preparation Products And Raw materials |
|