|
|
| | 1,4-Cyclohexanedicarboxylic acid Basic information |
| Product Name: | 1,4-Cyclohexanedicarboxylic acid | | Synonyms: | 1,4-Cyclohexanedicarboxylic acid, Mixture of cis and trans, 99+% 100GR;1,4-trans-cyclohexyldicarboxylic acid;cis+trans),1,4-Cyclohexanedicarboxylicacid(cis-andtra;Two1,4-cyclohexanecarboxylic acid;1, 4 - ring of adipic acid;1,4-Cyclohexanedicarboxylic acid (cis- and trans- mixture);1,4-Cyclohexanedicarboxylic acid 99%;1,4-CYCLOHEXANEDICARBOXYLIC ACID (CIS+TRANS) | | CAS: | 1076-97-7 | | MF: | C8H12O4 | | MW: | 172.18 | | EINECS: | 214-068-6 | | Product Categories: | 4-Substituted Cyclohexanecarboxylic Acids;Organic acids;Building Blocks;C8;Carbonyl Compounds;Carboxylic Acids;Chemical Synthesis;Organic Building Blocks;Pharmaceutical intermediates | | Mol File: | 1076-97-7.mol |  |
| | 1,4-Cyclohexanedicarboxylic acid Chemical Properties |
| Melting point | 164-167 °C(lit.) | | Boiling point | 262.49°C (rough estimate) | | density | 1.2104 (rough estimate) | | refractive index | 1.4450 (estimate) | | Fp | 235°C | | storage temp. | Sealed in dry,Room Temperature | | form | Powder | | pka | 4.38±0.10(Predicted) | | color | White to off-white | | Water Solubility | SOLUBLE | | BRN | 1870377 | | InChI | InChI=1S/C8H12O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12) | | InChIKey | PXGZQGDTEZPERC-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)CCC(C(O)=O)CC1 | | CAS DataBase Reference | 1076-97-7(CAS DataBase Reference) | | NIST Chemistry Reference | 1,4-Cyclohexanedicarboxylic acid(1076-97-7) | | EPA Substance Registry System | 1,4-Cyclohexanedicarboxylic acid (1076-97-7) |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | RTECS | GU9060000 | | TSCA | Yes | | HS Code | 29172090 |
| | 1,4-Cyclohexanedicarboxylic acid Usage And Synthesis |
| Chemical Properties | white fine crystalline powder | | Uses | 1,4-Cyclohexanedicarboxylic acid may be used in the synthesis of:
- polyesters
- polyamides
- poly(butylene adipate-co-butylene 1,4-cyclohexanedicarboxylate) copolyester
- various polyester polyols
| | Definition | ChEBI: 1,4-cyclohexanedicarboxylic acid is a dicarboxylic acid that is cyclohexane substituted by carboxy groups at positions 1 and 4. | | General Description | 1,4-Cyclohexanedicarboxylic acid (1,4-CHDA) has cyclohexane based structure. CHDA has better weatherability, higher impact strength, and faster stress relaxation. CHDA exhibits three isomeric forms:
- axial, axial (a,a) trans-isomer
- equatorial, equatorial (e,e) trans-isomer
- a,e cis-isomer
| | Flammability and Explosibility | Non flammable |
| | 1,4-Cyclohexanedicarboxylic acid Preparation Products And Raw materials |
|