calcium bicarbonate manufacturers
- calcium bicarbonate
-
- $980.00/ ton
-
2025-12-10
- CAS:3983-19-5
- Min. Order: 1ton
- Purity: 99%
- Supply Ability: 5000
- calcium bicarbonate
-
- $0.00 / 1KG
-
2025-06-27
- CAS:3983-19-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
- calcium bicarbonate
-
- $0.30 / 1KG
-
2021-11-15
- CAS:3983-19-5
- Min. Order: 2000KG
- Purity: 99.9%
- Supply Ability: 100tons
|
| | calcium bicarbonate Basic information |
| Product Name: | calcium bicarbonate | | Synonyms: | calcium bicarbonate;CALCIUMHYDROGENCARBONATE;calcium bis(hydrogencarbonate);Bis(carbonic acid hydrogen)calcium salt;calcium bicarbonate USP/EP/BP | | CAS: | 3983-19-5 | | MF: | CH4CaO3 | | MW: | 104.12 | | EINECS: | | | Product Categories: | | | Mol File: | 3983-19-5.mol |  |
| | calcium bicarbonate Chemical Properties |
| InChI | InChI=1S/CH2O3.Ca.2H/c2-1(3)4;;;/h(H2,2,3,4);;; | | InChIKey | DFRDXBRVQSUDPD-UHFFFAOYSA-N | | SMILES | C(O)(O)=O.[Ca] |
| | calcium bicarbonate Usage And Synthesis |
| Chemical Properties | Calcium bicarbonate is obtained by dissolving calcium carbonate in carbon dioxide aqueous solution, easily soluble in water, unstable, and decomposed by heating to form stalactite or scale. | | Uses | It can be used as calcium fortifier, emulsion stabilizer, dough conditioner, nutritional supplement, buffer, bulking agent, surface improver, emulsifier, curing agent, antioxidant synergist, and stabilizer. | | Synthesis | When calcium carbonate encounters carbon dioxide and water, chemical attack occurs, resulting in soluble calcium bicarbonate:
CaCO3+CO2+H2O=Ca(HCO3)2 |
| | calcium bicarbonate Preparation Products And Raw materials |
|