ethyl 5-amino-2H-1,2,4-triazole-3-carboxylate manufacturers
|
| | ethyl 5-amino-2H-1,2,4-triazole-3-carboxylate Basic information |
| Product Name: | ethyl 5-amino-2H-1,2,4-triazole-3-carboxylate | | Synonyms: | 3-amino-1H-1,2,4-triazole-5-carboxylic acid ethyl ester;ethyl 3-azanyl-1H-1,2,4-triazole-5-carboxylate;5-AMino-4H-[1,2,4]triazole-3-carboxylic acid ethyl ester;ethyl 5-amino-2H-1,2,4-triazole-3-carboxylate;ETHYL 5-AMINO-4H-[1,2,4]TRIAZOLE-3-CARBOXYLATE;NSC 148474;Ethyl 5-Amino-1,2,4-triazole-3-carboxylate;1H-1,2,4-Triazole-3-carboxylic acid, 5-amino-, ethyl ester | | CAS: | 63666-11-5 | | MF: | C5H8N4O2 | | MW: | 156.14 | | EINECS: | 675-026-4 | | Product Categories: | | | Mol File: | 63666-11-5.mol |  |
| | ethyl 5-amino-2H-1,2,4-triazole-3-carboxylate Chemical Properties |
| Melting point | 242-243℃ | | Boiling point | 373.9±25.0 °C(Predicted) | | density | 1.408 | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 8.92±0.40(Predicted) | | form | solid | | color | Off-white | | InChI | InChI=1S/C5H8N4O2/c1-2-11-4(10)3-7-5(6)9-8-3/h2H2,1H3,(H3,6,7,8,9) | | InChIKey | MLVNUTAJXZZPCJ-UHFFFAOYSA-N | | SMILES | N1C(N)=NC(C(OCC)=O)=N1 | | EPA Substance Registry System | 1H-1,2,4-Triazole-3-carboxylic acid, 5-amino-, ethyl ester (63666-11-5) |
| | ethyl 5-amino-2H-1,2,4-triazole-3-carboxylate Usage And Synthesis |
| | ethyl 5-amino-2H-1,2,4-triazole-3-carboxylate Preparation Products And Raw materials |
|