|
|
| | 1,3-bis(3-glycidoxypropyl)tetramethyldisiloxane Basic information |
| Product Name: | 1,3-bis(3-glycidoxypropyl)tetramethyldisiloxane | | Synonyms: | 1,1,3,3-tetramethyl-1,3-bis-(3-oxiranylmethoxy-propyl)-disiloxane;1,1,3,3-tetramethyl-1,3-bis[3-(oxiranylmethoxy)propyl]-disiloxan;1,1,3,3-tetramethyl-1,3-bis[3-(oxiranylmethoxy)propyl]-Disiloxane;1,3-Di(3-glycidoxypropyl)-1,1,3,3-tetramethyldisiloxane;NSC 93976;1,3-Bis(3-glycidoxypropyl)-1,1,3,3-tetraMethyldi;1,3-BIS(3-(2,3-EPOXYPROPOXY)PROPYL)TETRAMETHYLDISILOXANE;Bis-(3-glycidyloxypropyl)-tetramethyldisiloxane | | CAS: | 126-80-7 | | MF: | C16H34O5Si2 | | MW: | 362.61 | | EINECS: | 204-803-9 | | Product Categories: | Chemical Synthesis;Organometallic Reagents;Organosilicon;Siloxanes | | Mol File: | 126-80-7.mol |  |
| | 1,3-bis(3-glycidoxypropyl)tetramethyldisiloxane Chemical Properties |
| Melting point | <0°C | | Boiling point | 184 °C2 mm Hg(lit.) | | density | 0.996 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.452 | | Fp | 110°C | | form | liquid | | Specific Gravity | 0.996 | | Hydrolytic Sensitivity | 3: reacts with aqueous base | | BRN | 223966 | | InChI | InChI=1S/C16H34O5Si2/c1-22(2,9-5-7-17-11-15-13-19-15)21-23(3,4)10-6-8-18-12-16-14-20-16/h15-16H,5-14H2,1-4H3 | | InChIKey | MFIBZDZRPYQXOM-UHFFFAOYSA-N | | SMILES | [Si](C)(C)(CCCOCC1CO1)O[Si](C)(C)CCCOCC1CO1 | | EPA Substance Registry System | 1,1,3,3-Tetramethyl-1,3-bis[3-glycidyloxypropyl]disiloxane (126-80-7) |
| | 1,3-bis(3-glycidoxypropyl)tetramethyldisiloxane Usage And Synthesis |
| Uses | 1,3-Bis(3-glycidyloxypropyl)tetramethyldisiloxane can be used:
- As a starting material to synthesize functional poly(siloxane amine)s via an amine-epoxy click polymerization for material and biological applications.
- To prepare polymer electrolyte membranes (PEM) for fuel cell applications.
| | Synthesis | 1,1,3,3-Tetramethyldisiloxane and 1.1 equiv of allyl glycidyl ether (calculated to each Si-H group) were placed into the reaction vessel and heated up to 90 °C. Then the appropriate amount of [{Rh(OSiMe3)cod}2] (in the ratio 10-5 mol per mol Si-H) was added as a catalyst, and the reaction was continued for the next 2 h to give a crude product 1,3-bis(3-glycidoxypropyl)tetramethyldisiloxane.
 |
| | 1,3-bis(3-glycidoxypropyl)tetramethyldisiloxane Preparation Products And Raw materials |
|