|
|
| | 2-(2-methoxyphenyl)-1,3-benzoxazol-6-amine Basic information |
| | 2-(2-methoxyphenyl)-1,3-benzoxazol-6-amine Chemical Properties |
| Melting point | 140-143 °C | | Boiling point | 412.4±25.0 °C(Predicted) | | density | 1.257±0.06 g/cm3(Predicted) | | pka | 2.38±0.10(Predicted) | | form | solid | | InChI | 1S/C14H12N2O2/c1-17-12-5-3-2-4-10(12)14-16-11-7-6-9(15)8-13(11)18-14/h2-8H,15H2,1H3 | | InChIKey | FKBCPTRYFOWZPB-UHFFFAOYSA-N | | SMILES | NC1=CC2=C(C=C1)N=C(C(C=CC=C3)=C3OC)O2 |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |
| | 2-(2-methoxyphenyl)-1,3-benzoxazol-6-amine Usage And Synthesis |
| | 2-(2-methoxyphenyl)-1,3-benzoxazol-6-amine Preparation Products And Raw materials |
|