|
|
| | 5-FLUORO-2-METHYLBENZOTHIAZOLE Basic information |
| | 5-FLUORO-2-METHYLBENZOTHIAZOLE Chemical Properties |
| Boiling point | 110-112 °C7 mm Hg(lit.) | | density | 1.256 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.584(lit.) | | Fp | 185 °F | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | pka | 1.51±0.10(Predicted) | | color | Colourless to Pale Yellow | | Specific Gravity | 1.256 | | InChI | InChI=1S/C8H6FNS/c1-5-10-7-4-6(9)2-3-8(7)11-5/h2-4H,1H3 | | InChIKey | LDBFGRGBYVULTJ-UHFFFAOYSA-N | | SMILES | S1C2=CC=C(F)C=C2N=C1C | | CAS DataBase Reference | 399-75-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2934208090 | | Storage Class | 10 - Combustible liquids |
| | 5-FLUORO-2-METHYLBENZOTHIAZOLE Usage And Synthesis |
| Uses | 5-Fluoro-2-methylbenzothiazole is a useful reactant in the preparation of antileishmanial drug candidates. |
| | 5-FLUORO-2-METHYLBENZOTHIAZOLE Preparation Products And Raw materials |
|