|
|
| | Divinyltetramethyldisiloxane Basic information |
| Product Name: | Divinyltetramethyldisiloxane | | Synonyms: | LABOTEST-BB LT00067562;DIVINYLTETRAMETHYLDISILOXANE;1,3-diethenyl-1,1,3,3-tetramethyl-disiloxane;TETRAMETHYL-1,3-DIVINYLDISILOXANE;Bisvinyltetramethyldisiloxane;Disiloxane, 1,1,3,3-tetramethyl-1,3-divinyl-;Sym-tetramethyldi(ethenyl)disiloxane;Tetramethyldivinylsiloxane | | CAS: | 2627-95-4 | | MF: | C8H18OSi2 | | MW: | 186.4 | | EINECS: | 220-099-6 | | Product Categories: | organosilicon compound;Si (Classes of Silicon Compounds);monomer;Siloxanes;Si-O Compounds;Vinylsilanes, Allylsilanes;Industrial/Fine Chemicals;2627-95-4 | | Mol File: | 2627-95-4.mol |  |
| | Divinyltetramethyldisiloxane Chemical Properties |
| Melting point | -99 °C (lit.) | | Boiling point | 139 °C (lit.) | | density | 0.809 g/mL at 25 °C (lit.) | | vapor pressure | 17hPa at 25℃ | | refractive index | n20/D 1.411(lit.) | | Fp | 76 °F | | storage temp. | Flammables area | | form | liquid | | Specific Gravity | 0.811 | | color | colorless | | Water Solubility | insoluble | | Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems | | Sensitive | Moisture Sensitive | | BRN | 1762585 | | Cosmetics Ingredients Functions | CHELATING | | InChI | 1S/C8H18OSi2/c1-7-10(3,4)9-11(5,6)8-2/h7-8H,1-2H2,3-6H3 | | InChIKey | BITPLIXHRASDQB-UHFFFAOYSA-N | | SMILES | C[Si](C)(O[Si](C)(C)C=C)C=C | | LogP | 5.4 at 20℃ | | CAS DataBase Reference | 2627-95-4(CAS DataBase Reference) | | NIST Chemistry Reference | Disiloxane, 1,3-diethenyl-1,1,3,3-tetramethyl-(2627-95-4) | | EPA Substance Registry System | 1,3-Divinyl-1,1,3,3-tetramethyl disiloxane (2627-95-4) |
| Hazard Codes | F,Xi | | Risk Statements | 11-36/37/38-10 | | Safety Statements | 16-26-36-37/39 | | RIDADR | UN 1993 3/PG 2 | | WGK Germany | 2 | | RTECS | JM9235250 | | F | 10-21 | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29319090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 2 |
| | Divinyltetramethyldisiloxane Usage And Synthesis |
| Chemical Properties | Colorless or yellowish transparent liquid | | Uses | Divinyl tetramethyl disiloxane could be used as a additives(intermediates) in the production process of addition silicone rubber, silicone gel, liquid silicone, vinyl silicone resin, vinyl silicone oil, platinum chromium compound and others.
POTENTIAL VINYL NUCLEOPHILE IN CROSS-COUPLING REACTIONS. 1,3-Divinyltetramethyldisiloxane acts as a potential vinyl donor used in cross-coupling reactions. It is also involved in the copolymerization reaction with aromatic ketones. | | Preparation | The patent reports a method for preparing tetramethyldivinyldisiloxane, comprising the following steps: (1) mixing tetramethyldihydrogendisiloxane with a chloroplatinic acid catalyst to obtain a mixed solution; (2) bubbling acetylene into the mixed solution to carry out a hydrosilylation reaction, and after the reaction is completed, separating and purifying the reaction solution to obtain Divinyltetramethyldisiloxane. | | Flammability and Explosibility | Flammable | | Properties and Applications | Divinyltetramethyldisiloxane (DVTMSO) could used as a diolefin ligand in the complexes with d10-metal centers (M). This is a rather labile ligand capable of changing the π–π-bridging function to the chelating one in the ligand exchange reactions to form a stable six-membered cycle, for example, Pd(0)(CH2=CH–Si)2O. In addition, DVTMSO is the first representative of the series of unsaturated polysiloxanes, whose complexes, including those with Cu(I), serve as precursors for producing thin copper films by thermal disproportionation[1].
| | Toxics Screening Level | The Initial Threshold Screening Level (ITSL) for divinyltetramethyldisiloxane is being updated to 38 μg/m3 with an annual averaging time. | | References | [1] T. Duzak. “Tetragonal cubanoid Cu4X4 in the isostructural π-complexes with divinyltetramethyldisiloxane: [Cu4X4(C8H18OSi2) (X = Cl, Br).” Russian Journal of Coordination Chemistry 35 6 (2009): 416–421. |
| | Divinyltetramethyldisiloxane Preparation Products And Raw materials |
|