| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Perindopril-d4 CAS:1356929-58-2 Package:10Mg,1Mg
|
| Company Name: |
Cato Research Chemicals Inc.
|
| Tel: |
020-81960175 |
| Email: |
min.he@cato-chem.com |
| Products Intro: |
Product Name:Perindopril-d4 CAS:1356929-58-2 Purity:95% Package:25Mg, 50Mg
|
- Perindopril-d4
-
- $0.00 / 1mg
-
2025-08-21
- CAS:1356929-58-2
- Min. Order:
- Purity:
- Supply Ability: 10g
- Perindopril-D4
-
- $0.00 / 5mg
-
2023-05-27
- CAS:1356929-58-2
- Min. Order: 1mg
- Purity: 96%
- Supply Ability: 50 mg
|
| | Perindopril-d4 Basic information |
| Product Name: | Perindopril-d4 | | Synonyms: | Perindopril-d4;IPVQLZZIHOAWMC-UQXGGBCESA-N;Perindopril D4Q: What is
Perindopril D4 Q: What is the CAS Number of
Perindopril D4 Q: What is the storage condition of
Perindopril D4 Q: What are the applications of
Perindopril D4;(2S,3aS,7aS)-1-((S)-2-(((S)-1-Ethoxy-1-oxopentan-2-yl)amino)propanoyl)octahydro-1H-indole-2-carboxylic acid-d4 (Perindopril Impurity);D4-Perindopril | | CAS: | 1356929-58-2 | | MF: | C19H28D4N2O5 | | MW: | 372.492427112 | | EINECS: | | | Product Categories: | | | Mol File: | 1356929-58-2.mol |  |
| | Perindopril-d4 Chemical Properties |
| Melting point | 103-105°C | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChIKey | IPVQLZZIHOAWMC-ZBXUOUEYNA-N | | SMILES | N1(C(=O)[C@@]([2H])(N[C@@H](CCC)C(OCC)=O)C([2H])([2H])[2H])[C@]2([H])[C@@]([H])(CCCC2)C[C@H]1C(O)=O |&1:3,6,19,21,28,r| |
| | Perindopril-d4 Usage And Synthesis |
| Uses | Perindopril-d4 is the labeled analogue of Perindopril (P287500), an angiotensin-converting enzyme (ACE) inhibitor. Antihypertensive. |
| | Perindopril-d4 Preparation Products And Raw materials |
|