|
|
| | 2,6-DIFLUORO-3-METHYLANILINE Basic information |
| Product Name: | 2,6-DIFLUORO-3-METHYLANILINE | | Synonyms: | 3-Amino-2,4-difluorotoluene, 2,6-Difluoro-m-toluidine;2,6-DIFLUORO-3-METHYLANILINE;2,6-Difluoro-3-methyl-phenylamine;Benzenamine, 2,6-difluoro-3-methyl-;2,6-Difluoro-3-methylaniline,97%;2,6-DIFLUORO-3-METHYLANILINE ISO 9001：2015 REACH;2，6-difluoro-3-methylbenzeneamine | | CAS: | 144851-63-8 | | MF: | C7H7F2N | | MW: | 143.13 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 2,6-DIFLUORO-3-METHYLANILINE Chemical Properties |
| Boiling point | 170.9±35.0 °C(Predicted) | | density | 1.229±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | solubility | Soluble in organic solvents. | | pka | 1.94±0.10(Predicted) | | InChI | InChI=1S/C7H7F2N/c1-4-2-3-5(8)7(10)6(4)9/h2-3H,10H2,1H3 | | InChIKey | ZMNJSSZHDRBGNN-UHFFFAOYSA-N | | SMILES | C1(N)=C(F)C=CC(C)=C1F |
| HazardClass | 6.1 | | HS Code | 2921420090 |
| | 2,6-DIFLUORO-3-METHYLANILINE Usage And Synthesis |
| Uses | 2,6-Difluoro-3-methylaniline is used as a solvent is convenient as the pyridine can serve both as the solvent and the catalyst in the transformation. |
| | 2,6-DIFLUORO-3-METHYLANILINE Preparation Products And Raw materials |
|