1,3-DIFLUORO-2-PROPANOL manufacturers
- 1,3-Difluoro-2-propanol 99%
-
- $15.00 / 1KG
-
2021-07-02
- CAS:453-13-4
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 1,3-DIFLUORO-2-PROPANOL Basic information |
| | 1,3-DIFLUORO-2-PROPANOL Chemical Properties |
| Boiling point | 54-55 °C34 mm Hg(lit.) | | density | 1.24 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.373(lit.) | | Fp | 108 °F | | storage temp. | Flammables area | | solubility | soluble in DMSO, Methanol | | form | Liquid | | pka | 12.67±0.20(Predicted) | | color | Clear yellow to brownish | | BRN | 1732050 | | InChI | InChI=1S/C3H6F2O/c4-1-3(6)2-5/h3,6H,1-2H2 | | InChIKey | PVDLUGWWIOGCNH-UHFFFAOYSA-N | | SMILES | C(F)C(O)CF | | CAS DataBase Reference | 453-13-4(CAS DataBase Reference) | | EPA Substance Registry System | 2-Propanol, 1,3-difluoro- (453-13-4) |
| Hazard Codes | Xi,F | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-26-36 | | RIDADR | UN 1987 3/PG 3 | | WGK Germany | 3 | | RTECS | UB1770000 | | Hazard Note | Flammable | | TSCA | Y | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29055998 |
| | 1,3-DIFLUORO-2-PROPANOL Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS LIQUID | | Uses | 1,3-Difluoro-2-propanol was used in the synthesis of 1,3-difluoroacetone. |
| | 1,3-DIFLUORO-2-PROPANOL Preparation Products And Raw materials |
|