n-Butyryl tri-n-hexyl citrate manufacturers
- n-Butyryl tri-n-hexyl citrate
-
- $50.00 / 1KG
-
2025-09-25
- CAS:82469-79-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | n-Butyryl tri-n-hexyl citrate Basic information |
| Product Name: | n-Butyryl tri-n-hexyl citrate | | Synonyms: | 2,3-propanetricarboxylicacid,2-(1-oxobutoxy)-trihexylester;trihexylo-butyrylcitrate;n-Butyryl tri-n-hexyl citrate;BUTYRYL TRIHEXYL CITRATE;BTHC;TRIHEXYL O-BUTYRYLCITRATE 99%;Butyryl tri-n-hexyl citrate;Trihexyl 2-(butyryloxy)-1,2,3-propanetricarboxylate | | CAS: | 82469-79-2 | | MF: | C28H50O8 | | MW: | 514.69 | | EINECS: | 413-890-4 | | Product Categories: | | | Mol File: | 82469-79-2.mol |  |
| | n-Butyryl tri-n-hexyl citrate Chemical Properties |
| Melting point | −55 °C(lit.) | | Boiling point | 520.24°C (rough estimate) | | density | 0.993 | | vapor density | 17.7 (vs air) | | vapor pressure | 0Pa at 20-25℃ | | refractive index | n20/D 1.448(lit.) | | Fp | 113 °C | | storage temp. | 2-8°C | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Liquid | | color | Colorless to Light yellow | | Cosmetics Ingredients Functions | SKIN CONDITIONING - EMOLLIENT
PLASTICISER | | InChI | 1S/C28H50O8/c1-5-9-12-15-19-33-25(30)22-28(36-24(29)18-8-4,27(32)35-21-17-14-11-7-3)23-26(31)34-20-16-13-10-6-2/h5-23H2,1-4H3 | | InChIKey | GWVUTNGDMGTPFE-UHFFFAOYSA-N | | SMILES | CCCCCCOC(=O)CC(CC(=O)OCCCCCC)(OC(=O)CCC)C(=O)OCCCCCC | | LogP | 4 at 21℃ and pH5.7 | | EPA Substance Registry System | 1,2,3-Propanetricarboxylic acid, 2-(1-oxobutoxy)-, trihexyl ester (82469-79-2) |
| WGK Germany | WGK 3 | | TSCA | TSCA listed | | HS Code | 2918.15.5000 | | Storage Class | 10 - Combustible liquids |
| | n-Butyryl tri-n-hexyl citrate Usage And Synthesis |
| Uses | Trihexyl O-Butyrylcitrate is a non-toxic plasticizer, widely used in non-toxic PVC granulation, medical products, soft children's toys, ink coatings, etc. | | Application | Trihexyl O-Butyrylcitrate can be used as an intermediate in pharmaceutical synthesis. | | Synthesis | Trihexyl O-Butyrylcitrate was prepared as follows: 1) To a 1 liter four-neck flask equipped with a stirrer, immersion thermometer, subsurface nitrogen sparge tube and Barrett trap with condenser 330 g n-hexanol, 180 g citric acid and 50 ml heptane. The reaction mass was heated to reflux (about 120°C) with a heating mantle and 1.5 grams of tetra-n-butyl titanate esterification catalyst was added. The reaction mass was esterified at 120-140°C until the acidity was less than 2 mgKOH/g acidity. The pressure was reduced to 20 mmHg using a vacuum pump to distill off excess n-hexanol and heptane azeotrope. The ester-containing reaction mass was then stripped with fresh steam at a temperature of 130-140° C. and full vacuum until no residual n-hexanol was detected by gas chromatography.
2) The ester-containing reaction mass was cooled to 90°C, and 0.4 g of concentrated sulfuric acid was added dropwise with stirring. n-Butyric anhydride (166 g) was added dropwise with stirring, maintaining the acylation temperature between 90-110°C. The acylation reaction mixture was stirred and allowed to proceed for 2 hours to prepare the acylated ester. response quality. By-product butyric acid was removed by vacuum distillation at 110°C. |
| | n-Butyryl tri-n-hexyl citrate Preparation Products And Raw materials |
|