|
|
| | GTP LITHIUM SALT Basic information |
| Product Name: | GTP LITHIUM SALT | | Synonyms: | GTP DILITHIUM SALT;GTP, LI;GTP, LI2H2;GTP LITHIUM SALT;GTP 2LI;GUANOSINE 5'-TRIPHOSPHATE DILITHIUM SALT;GUANOSINE-5'-TRIPHOSPHORIC ACID, DILITHIUM;GUANOSINE-5'-TRIPHOSPHORIC ACID, LITHIUM | | CAS: | 85737-04-8 | | MF: | C10H15LiN5O14P3 | | MW: | 529.11 | | EINECS: | 288-514-3 | | Product Categories: | | | Mol File: | 85737-04-8.mol |  |
| | GTP LITHIUM SALT Chemical Properties |
| storage temp. | -20°C | | solubility | H2O: 100 mg/mL | | form | powder | | color | white | | Water Solubility | H2O: 100mg/mL | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChIKey | WDCLDKGIVWUKSE-GWTDSMLYSA-M | | SMILES | [Li+].NC1=Nc2c(ncn2[C@@H]3O[C@H](COP(O)(=O)OP(O)(=O)OP(O)([O-])=O)[C@@H](O)[C@H]3O)C(=O)N1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | GTP LITHIUM SALT Usage And Synthesis |
| Uses | Guanosine 5′-triphosphate lithium salt has been used:
- In ribosome activity assay.
- In tubulin isolation and polymerization.
- In the determination of cell viability.
| | Biochem/physiol Actions | GTP functions as a carrier of phosphates and pyrophosphates involved in channeling chemical energy into specific biosynthetic pathways. GTP activates the signal transducing G proteins which are involved in various cellular processes including proliferation, differentiation, and activation of several intracellular kinase cascades. Proliferation and apoptosis are regulated in part by the hydrolysis of GTP by small GTPases Ras and Rho. Another type of small GTPase, Rab, plays a role in the docking and fusion of vesicles and may also be involved in vesicle formation. In addition to its role in signal transduction, GTP also serves as an energy-rich precursor of mononucleotide units in the enzymatic biosynthesis of DNA and RNA. |
| | GTP LITHIUM SALT Preparation Products And Raw materials |
|