| Company Name: |
Molsyns Research
|
| Tel: |
+91-9586858886 |
| Email: |
info@molsyns.com |
| Products Intro: |
Product Name:Atenolol Impurity-E
CAS:141650-31-9
Purity:98% Package:25mg; 50mg;100mg and 1 g
|
|
| | 4,4'-(2-HYDROXY-1,3-PROPANDIYLDIOXY)BIS(2-PHENYLACETAMIDE) Basic information |
| Product Name: | 4,4'-(2-HYDROXY-1,3-PROPANDIYLDIOXY)BIS(2-PHENYLACETAMIDE) | | Synonyms: | ATENOLOL IMPURITY E;4,4'-(2-HYDROXY-1,3-PROPANDIYLDIOXY)BIS(2-PHENYLACETAMIDE);Atenolol Impurity 5（Atenolol EP Impurity E）;2,2'-[(2-Hydroxypropane-1,3-diyl)bi;Benzeneacetamide, 4,4'-[(2-hydroxy-1,3-propanediyl)bis(oxy)]bis-;4,4'-[(2-Hydroxy-1,3-propanediyl)bis(oxy)]bis-benzeneacetamide;2-[4-[3-[4-(2-amino-2-oxoethyl)phenoxy]-2-hydroxypropoxy]phenyl]acetamide;Atenlol Imp E | | CAS: | 141650-31-9 | | MF: | C19H22N2O5 | | MW: | 358.39 | | EINECS: | | | Product Categories: | Aromatics, Impurities, Pharmaceuticals, Intermediates & Fine Chemicals | | Mol File: | 141650-31-9.mol |  |
| | 4,4'-(2-HYDROXY-1,3-PROPANDIYLDIOXY)BIS(2-PHENYLACETAMIDE) Chemical Properties |
| Melting point | >205°C (dec.) | | Boiling point | 696.1±55.0 °C(Predicted) | | density | 1.280±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Ethanol (Slightly, Heated), Methanol (Slightly, Heated, Sonicated) | | form | Solid | | pka | 13.35±0.20(Predicted) | | color | Off-White to Light Brown | | Major Application | pharmaceutical (small molecules) | | InChI | 1S/C19H22N2O5/c20-18(23)9-13-1-5-16(6-2-13)25-11-15(22)12-26-17-7-3-14(4-8-17)10-19(21)24/h1-8,15,22H,9-12H2,(H2,20,23)(H2,21,24) | | InChIKey | RJTRBVLDVHIXNJ-UHFFFAOYSA-N | | SMILES | NC(=O)Cc1ccc(cc1)OCC(O)COc2ccc(cc2)CC(=O)N |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4,4'-(2-HYDROXY-1,3-PROPANDIYLDIOXY)BIS(2-PHENYLACETAMIDE) Usage And Synthesis |
| Uses | 4,4''-[(2-Hydroxy-1,3-propanediyl)bis(oxy)]bis-benzeneacetamide is an impurity of Atenolol (A790075), a cardioselective β-adrenergic blocker. Atenolol EP Impurity E | | Uses | 4,4'-[(2-Hydroxy-1,3-propanediyl)bis(oxy)]bis-benzeneacetamide is an impurity of Atenolol (A790075), a cardioselective β-adrenergic blocker. |
| | 4,4'-(2-HYDROXY-1,3-PROPANDIYLDIOXY)BIS(2-PHENYLACETAMIDE) Preparation Products And Raw materials |
|