|
|
| | 2-Amino-4,5-bis(2-methoxyethoxy)benzoic acid ethyl ester hydrochloride Basic information |
| Product Name: | 2-Amino-4,5-bis(2-methoxyethoxy)benzoic acid ethyl ester hydrochloride | | Synonyms: | Ethyl 4,5-bis(2-Methoxyethoxy)-2-aMinobenzoate Hydrochloride;2-AMino-4,5-bis(2-Methoxyethoxy)benzoic acid ethyl;2-Amino-4,5-bis(2-methoxyethoxy)benzoic acid ethyl ester hydrochloride;Ethyl 2-amino-4,5-bis(2-methoxyethoxy)-benzoate hydrochloride;Benzoic acid, 2-aMino-4,5-bis(2-Methoxyethoxy)-, ethyl ester, hydrochloride (1:1);2-Amino-4,5-bis(2-methoxyethoxy)benzoic acid ethyl ester hydrochlorid;ETHYL 2-AMINO-4,5-...;Erlotinib Impurity 7 HCl | | CAS: | 183322-17-0 | | MF: | C15H24ClNO6 | | MW: | 349.81 | | EINECS: | | | Product Categories: | | | Mol File: | 183322-17-0.mol |  |
| | 2-Amino-4,5-bis(2-methoxyethoxy)benzoic acid ethyl ester hydrochloride Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | InChI | InChI=1S/C15H23NO6.ClH/c1-4-20-15(17)11-9-13(21-7-5-18-2)14(10-12(11)16)22-8-6-19-3;/h9-10H,4-8,16H2,1-3H3;1H | | InChIKey | CVAXGYHQKOQSDV-UHFFFAOYSA-N | | SMILES | O(C1C=C(C(=O)OCC)C(N)=CC=1OCCOC)CCOC.Cl |
| | 2-Amino-4,5-bis(2-methoxyethoxy)benzoic acid ethyl ester hydrochloride Usage And Synthesis |
| Uses | Ethyl 2-Amino-4,5-bis(2-methoxyethoxy)benzoate Hydrochloride is acidic salt of 2-Amino-4,5-bis(2-methoxyethoxy)benzoic Acid Ethyl Ester(A602006); an intermediate in the synthesis of Erlotinib (E625000, HCl); a selective epidermal growth factor receptor (EGFR)-tyrosine kinase inhibitor and antineoplastic agent. |
| | 2-Amino-4,5-bis(2-methoxyethoxy)benzoic acid ethyl ester hydrochloride Preparation Products And Raw materials |
|