|
| Octahydro-1H-indole-2-carboxylic acid Basic information |
| Octahydro-1H-indole-2-carboxylic acid Chemical Properties |
Melting point | 233-234 °C (decomp)(Solv: 1,4-dioxane (123-91-1); water (7732-18-5)) | Boiling point | 318.6±25.0 °C(Predicted) | density | 1.135±0.06 g/cm3(Predicted) | storage temp. | -15°C | solubility | Methanol (Slightly), Water (Slightly) | form | Solid | pka | 2.47±0.20(Predicted) | color | White to Off-White | InChI | InChI=1/C9H15NO2/c11-9(12)8-5-6-3-1-2-4-7(6)10-8/h6-8,10H,1-5H2,(H,11,12)/t6-,7-,8-/s3 | InChIKey | CQYBNXGHMBNGCG-VTCOHLDGNA-N | SMILES | N1[C@@]2([H])[C@]([H])(CCCC2)C[C@@H]1C(O)=O |&1:1,3,10,r| | CAS DataBase Reference | 80828-13-3(CAS DataBase Reference) |
| Octahydro-1H-indole-2-carboxylic acid Usage And Synthesis |
Chemical Properties | White Crystalline Solid | Uses | (2R,3aR,7aR)-rel-OctahydroIndole-2-carboxylic Acid is a reactant in the preparation of Perindoprilat (P287530), an angiotensin-converting enzyme (ACE) inhibitor. Antihypertensive. | Uses | Trandolapril intermediate |
| Octahydro-1H-indole-2-carboxylic acid Preparation Products And Raw materials |
|