|
|
| | 5-alpha-Hydroxy- Laxogenin Basic information | | Uses |
| Product Name: | 5-alpha-Hydroxy- Laxogenin | | Synonyms: | Spirostan-6-one, 3,5-dihydroxy-, (3b,5a,25R)-;DI 31;Brassinosteroid BB 16;Biobras 16;BB 16;(3beta,5alpha,25R)-3,5-Dihydroxyspirostan-6-one;(2AR,2'R,4S,5'R,6aR,6bS,8aS,8bR,9S,11aS,12aS,12bS)-2a,4-dihydroxy-5',6a,8a,9-tetramethylicosahydrospiro[naphtho[2',1':4,5]indeno[2,1-b]furan-10,2'-pyran]-2(11aH)-one;laxogenin 99% | | CAS: | 56786-63-1 | | MF: | C27H42O5 | | MW: | 446.62 | | EINECS: | 1312995-182-4 | | Product Categories: | 56786-63-1 | | Mol File: | 56786-63-1.mol |  |
| | 5-alpha-Hydroxy- Laxogenin Chemical Properties |
| Melting point | 247-250 °C | | Boiling point | 578.4±50.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMF: 15 mg/ml; DMSO: 10 mg/ml | | form | A solid | | pka | 12.62±0.70(Predicted) | | InChIKey | HCRGPOQBVFMZFY-YPAZECSTNA-N | | SMILES | C1C[C@]2(C)C3CC[C@]4(C)C5[C@H](C)C6(OC[C@H](C)CC6)OC5CC4C3CC(=O)[C@@]2(O)C[C@H]1O |&1:2,7,10,15,27,30,r| |
| | 5-alpha-Hydroxy- Laxogenin Usage And Synthesis |
| Uses | 5α-Hydroxy laxogenin is a synthetic derivative of a naturally occurring spirostane-type steroid, laxogenin. It is a synthetic spirostane-type steroid, which is contained in dietary supplements and advertised as anabolic agent. | | Description | 5α-hydroxy Laxogenin is a brassinosteroid analog and a derivative of diosgenin.Topical administration of 5α-hydroxy laxogenin (4, 8, and 12 ppm), in combination with a commercial fertilizer, increases the yield and fresh weight of endives (C. endivia).It also inhibits sodium chloride-induced decreases in the fresh weight of lettuce shoots and roots when applied topically at concentrations of 0.1 and 1 μM, as well as inhibits increases in ethylene emission at a concentration of 1 μM. |
| | 5-alpha-Hydroxy- Laxogenin Preparation Products And Raw materials |
|