|
|
| | (1S,2R)-2-(3,4-Difluorophenyl)-cyclopropanaMine Basic information |
| Product Name: | (1S,2R)-2-(3,4-Difluorophenyl)-cyclopropanaMine | | Synonyms: | (1S,2R)-2-(3,4-Difluoro-phenyl)-cyclopropylamine;((1S,2R)-2-(3,4-Difluorophenyl)cyclopropanamine HCl);trans-(1S,2R)-2-(3,4-difluorophenyl)-cyclopropylamine;(1S,2R)-2-(3,4-Difluorophenyl)cyclopropan-1-amine;cis-2-(3,4-difluorophenyl) cyclopropanamine
(1S,2R)-2-(3,4-difluorophenyl)cyclopropanamine;Ticagrelor Related Compound VIII;(1S,2R)-2-(3,4-difluorophenyl);Cyclopropanamine, 2-(3,4-difluorophenyl)-, (1S,2R)- | | CAS: | 1345413-20-8 | | MF: | C9H9F2N | | MW: | 169.17 | | EINECS: | | | Product Categories: | | | Mol File: | 1345413-20-8.mol |  |
| | (1S,2R)-2-(3,4-Difluorophenyl)-cyclopropanaMine Chemical Properties |
| Boiling point | 212.5±40.0 °C(Predicted) | | density | 1.268±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 8.07±0.70(Predicted) | | form | Solid | | color | White | | InChI | InChI=1S/C9H9F2N/c10-7-2-1-5(3-8(7)11)6-4-9(6)12/h1-3,6,9H,4,12H2/t6-,9+/m1/s1 | | InChIKey | QVUBIQNXHRPJKK-MUWHJKNJSA-N | | SMILES | [C@H]1(N)C[C@@H]1C1=CC=C(F)C(F)=C1 |
| | (1S,2R)-2-(3,4-Difluorophenyl)-cyclopropanaMine Usage And Synthesis |
| Uses | (1S,2R)-2-(3,4-Difluorophenyl)-cyclopropanamine is an intermediate used to prepare ticagrelor (T437700). |
| | (1S,2R)-2-(3,4-Difluorophenyl)-cyclopropanaMine Preparation Products And Raw materials |
|