| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- Gallocyanine
-
- $49.00
-
2026-07-15
- CAS:1562-85-2
- Purity:
- Supply Ability: 10g
- GALLOCYANINE
-
- $1.00
-
2019-07-12
- CAS:1562-85-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 25kg
- GALLOCYANINE
-
- $1.00
-
2019-07-06
- CAS:1562-85-2
- Min. Order: 1KG
- Purity: 95%-99.99%
- Supply Ability: 1kg-10MT
|
| | GALLOCYANINE Basic information |
| Product Name: | GALLOCYANINE | | Synonyms: | FAST VIOLET;GALLOCYANIN;GALLOCYANINE;CI NO 51030;CHROME BLUE GCB;CI 51030;ALIZARIN BLUE RBN;7-DIMETHYLAMINO-4-HYDROXY-3-OXO-3H-PHENOXAZINE-1-CARBOXYLIC ACID | | CAS: | 1562-85-2 | | MF: | C15H13ClN2O5 | | MW: | 336.73 | | EINECS: | 216-345-7 | | Product Categories: | | | Mol File: | 1562-85-2.mol |  |
| | GALLOCYANINE Chemical Properties |
| density | 1.3979 (rough estimate) | | refractive index | 1.6500 (estimate) | | storage temp. | room temp | | solubility | PBS (pH 7.2): 10 mg/ml | | Colour Index | 51030 | | form | Fine Crystalline Powder | | color | Very dark green to black | | Water Solubility | Soluble in water (10 mg/ml), 100% ethanol (10 mg/ml), alcohol, 1N NH4OH (10 mg/ml), and DMSO (25 mg/ml). | | λmax | 601 nm | | Merck | 14,4355 | | BRN | 307454 | | Stability: | Stable. Incompatible with strong oxidizing agents. | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C15H12N2O5.ClH/c1-17(2)7-3-4-9-11(5-7)22-14-12(16-9)8(15(20)21)6-10(18)13(14)19;/h3-6H,1-2H3,(H2-,16,18,19,20,21);1H | | InChIKey | ADAUKUOAOMLVSN-UHFFFAOYSA-N | | SMILES | [Cl-].C\[N+](C)=C1\C=CC2=Nc3c(OC2=C1)c(O)c(O)cc3C(O)=O |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36/37 | | WGK Germany | 3 | | RTECS | SP7692000 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | GALLOCYANINE Usage And Synthesis |
| Chemical Properties | black powder | | Uses | Gallocyanine is used as an intermediate in chemical research. It is a small molecule dye that also inhibits DKK1 of the Wnt pathway. | | Uses | As a dye; in alkali carbonate solution as a reagent for lead with which it forms a deep violet color. | | Preparation | excessive amounts of N,N-dimethyl-4-nitrosobenzenamine and3,4,5-Trihydroxybenzoic acid in methanol reaction (incomplete reaction in ethanol). | | Definition | ChEBI: Gallocyanin is an organic chloride salt composed of 1-carboxy-7-(dimethylamino)-3,4-dihydroxyphenoxazin-5-ium and chloride ions in a 1:1 ratio. A histological dye used in solution with an iron alum mordant as a hematoxylin substitute in the H&E stain. It has a role as a fluorochrome and a histological dye. It contains a gallocyanin(1+). | | General Description | Gallocyanine belongs to the oxazine class of dyes. It is synthesised from methanol solution of gallic acid in the presence of excess iodine. Gallocyanine is used to stain animal cells, mostly the nucleic acids. It also acts as a chelating agent and is used to determine bioactive compounds and several metal ions. | | Properties and Applications | red light navy blue. Insoluble in water, slightly soluble in ethanol for blue purple. In concentrated sulfuric acid for Daisy blue, dilution after magenta. Dye aqueous solution to join sodium hydroxide as red light purple.
|
Standard
|
Ironing Fastness
|
Light Fastness
|
Fulling
|
Persperation Fastness
|
Soaping
|
Water
|
|
Alkali
|
Acid
|
|
ISO
|
4
|
6
|
3-4
|
|
5
|
4
|
|
|
| | GALLOCYANINE Preparation Products And Raw materials |
|