|
|
| | Bis(triphenylphosphine)iminium chloride Basic information |
| | Bis(triphenylphosphine)iminium chloride Chemical Properties |
| Melting point | 270-272 °C(lit.) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Powder | | color | white | | Water Solubility | Moderately soluble in water. | | BRN | 4097979 | | InChI | InChI=1S/C36H30ClNP2/c37-40(34-25-13-4-14-26-34,35-27-15-5-16-28-35,36-29-17-6-18-30-36)38-39(31-19-7-1-8-20-31,32-21-9-2-10-22-32)33-23-11-3-12-24-33/h1-30H | | InChIKey | QMTYWEYUVVWPQL-UHFFFAOYSA-N | | SMILES | P(Cl)(C1C=CC=CC=1)(C1C=CC=CC=1)(C1C=CC=CC=1)N=P(C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1 | | CAS DataBase Reference | 21050-13-5(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20 | | Safety Statements | 26-36-38-36/37/39-22 | | WGK Germany | 3 | | F | 10 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Inhalation
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Bis(triphenylphosphine)iminium chloride Usage And Synthesis |
| Uses | Co-catalyst used with a chiral Cobalt-salen complex for the asymmetric addition of carbon dioxide to propylene oxide. Also used in the preparation of 5-Hydroxy-clethodim Sulfoxide. | | Uses | suzuki reaction | | Uses | Bis(triphenylphosphoranylidene)ammonium chloride was used in two-phase titration and electrochemistry, done for physiochemical characterization of sildenafil. It was also used in cyclic voltammetry reactions, used to study ion transfer (IT) and electron transfer (ET), at a liquid-liquid interface supported on a metallic electrode. | | General Description | Visit our Sensor Applications portal to learn more. |
| | Bis(triphenylphosphine)iminium chloride Preparation Products And Raw materials |
|