|
|
| | 4-(FLUOROSULFONYL)BENZOIC ACID Basic information |
| | 4-(FLUOROSULFONYL)BENZOIC ACID Chemical Properties |
| Melting point | 272-273 °C (lit.) | | Boiling point | 335.3±25.0 °C(Predicted) | | density | 1.538±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 3.29±0.10(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C7H5FO4S/c8-13(11,12)6-3-1-5(2-4-6)7(9)10/h1-4H,(H,9,10) | | InChIKey | DJUJJHDCOUPERR-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccc(cc1)S(F)(=O)=O |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 4-(FLUOROSULFONYL)BENZOIC ACID Usage And Synthesis |
| Uses | 4-(Fluorosulfonyl)benzoic acid was used as an affinity label of dimeric pig lung pi class glutathione S-transferase. | | General Description | 4-(Fluorosulfonyl)benzoic acid is a a xenobiotic substrate analogue which on incubation with 4-4 isozyme of rat liver glutathione S-transferase results in a time-dependent inactivation of the enzyme. | | reaction suitability | reaction type: click chemistry |
| | 4-(FLUOROSULFONYL)BENZOIC ACID Preparation Products And Raw materials |
|