|
|
| | 3-AMINO-PYRIDINE-4-CARBALDEHYDE Basic information |
| | 3-AMINO-PYRIDINE-4-CARBALDEHYDE Chemical Properties |
| Melting point | ca 92℃ | | Boiling point | 333.3±27.0 °C(Predicted) | | density | 1.264±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | pka | 4.19±0.18(Predicted) | | form | solid | | Appearance | Light yellow to yellow Solid | | Water Solubility | Slightly soluble in water. | | Sensitive | Air Sensitive | | InChI | InChI=1S/C6H6N2O/c7-6-3-8-2-1-5(6)4-9/h1-4H,7H2 | | InChIKey | NDEGFXFYOKVWAK-UHFFFAOYSA-N | | SMILES | C1=NC=CC(C=O)=C1N | | CAS DataBase Reference | 55279-29-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 3-AMINO-PYRIDINE-4-CARBALDEHYDE Usage And Synthesis |
| Uses | 3-Aminopyridine-4-carboxaldehyde is used as pharmaceutical intermediate. | | Uses | 3-Amino-pyridine-4-carbaldehyde is used in the preparation of hydroxyquinolin-2(1H)-ones and derivatives thereof for treating cognitive-related disorders and neuropathic pain disorders. | | Synthesis | A chloroform (100 mL) solution of (3-aminopyridin-4-yl)-methanol (10.4 g) and manganese dioxide (50.3 g) was at room temperature.
stirred for 18 hours. The reaction solution was filtered through Celite and concentrated to give the title compound (10.1 g).LC-MS ([M+H]+/Rt (min)):
123.0/0.218. |
| | 3-AMINO-PYRIDINE-4-CARBALDEHYDE Preparation Products And Raw materials |
|