- H-TYR(TBU)-OME HCL
-
- $1.00 / 1KG
-
2019-07-06
- CAS: 51482-39-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
- H-TYR(TBU)-OME HCL
-
- $1.00 / 1KG
-
2019-07-06
- CAS:51482-39-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | H-TYR(TBU)-OME HCL Basic information |
| Product Name: | H-TYR(TBU)-OME HCL | | Synonyms: | TYROSINE(TBU)-OME HCL;O-T-BUTYL-L-TYROSINE METHYL ESTER HYDROCHLORIDE;O-T-BUTYL-L-TYROSINE METHYL ESTER HYDROCHLORIDE SALT;O-TERT-BUTYL-L-TYROSINE METHYL ESTER HYDROCHLORIDE;methyl O-tert-butyl-L-tyrosinate hydrochloride;O-TERT-BUTYL-L-TYROSINE METHYL ESTER HYD;(S)-Methyl 2-aMino-3-(4-(tert-butoxy)phenyl)propanoate hydrochloride;O-tert-Butyl-L-tyrosine methyl ester hydrochloride >=98.0% | | CAS: | 51482-39-4 | | MF: | C14H22ClNO3 | | MW: | 287.78 | | EINECS: | 257-234-3 | | Product Categories: | Amino Acids and Derivatives;Amino Acid Derivatives;Amino Acids | | Mol File: | 51482-39-4.mol |  |
| | H-TYR(TBU)-OME HCL Chemical Properties |
| storage temp. | Inert atmosphere,2-8°C | | form | flakes | | Appearance | White to off-white Solid | | BRN | 7696272 | | Major Application | peptide synthesis | | InChI | 1S/C14H21NO3.ClH/c1-14(2,3)18-11-7-5-10(6-8-11)9-12(15)13(16)17-4;/h5-8,12H,9,15H2,1-4H3;1H/t12-;/m0./s1 | | InChIKey | PAFVAMWJVIIMQK-YDALLXLXSA-N | | SMILES | Cl.COC(=O)[C@@H](N)Cc1ccc(OC(C)(C)C)cc1 | | CAS DataBase Reference | 51482-39-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36-43 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Sens. 1 |
| | H-TYR(TBU)-OME HCL Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | H-TYR(TBU)-OME HCL Preparation Products And Raw materials |
|