| Company Name: |
Guangzhou Austine Biotechnology Co., LTD Gold
|
| Tel: |
17727342298 |
| Email: |
2781109436@qq.com |
| Products Intro: |
Product Name:Minocycline 5,6a-Dehydro Impurity
CAS:1346598-44-4
Purity:95% HPLC Package:1g
|
Minocycline 5,6a-Dehydro Impurity manufacturers
|
| | Minocycline 5,6a-Dehydro Impurity Basic information |
| Product Name: | Minocycline 5,6a-Dehydro Impurity | | Synonyms: | Minocycline 5,6a-Dehydro Impurity;GUNFOZREGBRAGY-RYNWUYHSSA-N;2-Naphthacenecarboxamide, 4,7-bis(dimethylamino)-1,4,4a,5,12,12a-hexahydro-3,10,11,12a-tetrahydroxy-1,12-dioxo-, (4R,4aR,12aR)-rel-;Δ5a-11-Hydroxy-12-oxo Minocycline;Minocycline 5,6α-Dehydro Impurity;Minocycline 5,6alpha-Dehydro Impurity;Minocycline EP Impurity H;(4S,4aS,12aS)-4,7-Bis(dimethylamino)-3,10,11,12a-tetrahydroxy-1,12-dioxo-1,4,4a,5,12,12a-hexahydrotetracene-2-carboxamide (Minocycline Impurity） | | CAS: | 1346598-44-4 | | MF: | C23H25N3O7 | | MW: | 455.46 | | EINECS: | | | Product Categories: | | | Mol File: | 1346598-44-4.mol |  |
| | Minocycline 5,6a-Dehydro Impurity Chemical Properties |
| Boiling point | 698.0±55.0 °C(Predicted) | | density | 1.58±0.1 g/cm3(Predicted) | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.50±1.00(Predicted) | | color | Light Yellow to Dark Brown | | Stability: | Light sensitive | | InChIKey | GUNFOZREGBRAGY-YLJZHGKANA-N | | SMILES | C1(=O)[C@@]2(O)[C@]([H])(CC3=C(C2=O)C(O)=C2C(C(N(C)C)=CC=C2O)=C3)[C@@H](N(C)C)C(O)=C1C(N)=O |&1:2,4,24,r| |
| | Minocycline 5,6a-Dehydro Impurity Usage And Synthesis |
| Uses | An impurity of Minocycline (M344800), which is a second generation tetracycline antibiotic. This compound has neuroprotective properties. |
| | Minocycline 5,6a-Dehydro Impurity Preparation Products And Raw materials |
|