|
|
| | 4,4'-Azobis(4-cyanovaleric acid) Basic information |
| | 4,4'-Azobis(4-cyanovaleric acid) Chemical Properties |
| Melting point | 118-125 °C (dec.) (lit.) | | Boiling point | 423°C (rough estimate) | | density | 1.2464 (rough estimate) | | refractive index | 1.6081 (estimate) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.98±0.10(Predicted) | | color | White | | Water Solubility | Soluble in water. | | Sensitive | Light Sensitive | | BRN | 1729856 | | InChI | 1S/C12H16N4O4/c1-11(7-13,5-3-9(17)18)15-16-12(2,8-14)6-4-10(19)20/h3-6H2,1-2H3,(H,17,18)(H,19,20)/b16-15+ | | InChIKey | VFXXTYGQYWRHJP-FOCLMDBBSA-N | | SMILES | CC(CCC(O)=O)(\N=N\C(C)(CCC(O)=O)C#N)C#N | | LogP | 0.8 at 23℃ | | CAS DataBase Reference | 2638-94-0(CAS DataBase Reference) | | NIST Chemistry Reference | 4,4'-Azo-bis(4-cyanopentanoic acid)(2638-94-0) | | EPA Substance Registry System | 4,4'-Azobis(4-cyanovaleric acid) (2638-94-0) |
| Hazard Codes | F | | Risk Statements | 11 | | Safety Statements | 15-16-22-24/25-36 | | RIDADR | UN 1325 4.1/PG 2 | | WGK Germany | 2 | | RTECS | YV6190500 | | F | 4.4-8 | | TSCA | TSCA listed | | HazardClass | 4.1 | | HS Code | 29270000 | | Storage Class | 5.2 - Organic peroxides and self-reacting hazardous materials | | Hazard Classifications | Self-react. D | | Toxicity | LD50 ipr-mus: 666 mg/kg 85JCAE -,922,86 |
| | 4,4'-Azobis(4-cyanovaleric acid) Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | 4,4′-Azobis(4-cyanovaleric acid) has been used in the preparation of polystyrene particles by polymerizing styrene in ethyl alcohol. | | Uses | 4,4'-Azobis(4-cyanovaleric acid) is used as a free radical imitator in polymer synthesis such as polyvinyl chloride, polyacrylonitrile, polyvinyl alcohol and synthetic fibers. It is utilized for both heterogeneous and homogenous free-radical polymerizations, and as an initiator in reversible addition-fragmentation chain transfer polymerization (RAFT). It is also used as a blowing agent for plastics and elastomers. | | Uses | 4,4’Azobis(4-cyanovaleric Acid) is a water soluble azo initiator usded in radical polymerization process of vinyls, acylamides, styrenes as well as other polymers. | | Hazard | Toxic. | | Flammability and Explosibility | Not classified | | Biochem/physiol Actions | 4,4′-azobis(4-cyanovaleric acid) is an azo-initiator that induces lipid peroxidation of sunflower oil. | | Safety Profile | Moderately toxic byintraperitoneal route. When heated to decomposition itemits toxic vapors of NOx. |
| | 4,4'-Azobis(4-cyanovaleric acid) Preparation Products And Raw materials |
|